EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H36N4O4 |
| Net Charge | 0 |
| Average Mass | 576.697 |
| Monoisotopic Mass | 576.27366 |
| SMILES | C=CC1=C(C)c2cc3nc(cc4nc(cc5nc(cc1n2)c(C)c5CCC(=O)OC)C(CCC(=O)O)=C4C)c(C)c3C=C |
| InChI | InChI=1S/C35H36N4O4/c1-8-22-18(3)26-14-27-20(5)24(10-12-34(40)41)32(38-27)17-33-25(11-13-35(42)43-7)21(6)29(39-33)16-31-23(9-2)19(4)28(37-31)15-30(22)36-26/h8-9,14-17,36,39H,1-2,10-13H2,3-7H3,(H,40,41)/b26-14-,27-14-,28-15-,29-16-,30-15-,31-16-,32-17-,33-17- |
| InChIKey | UQTUZBGPJOOSQY-RYKNAGBNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| protoporphyrin monomethyl ester (CHEBI:36160) has functional parent protoporphyrin (CHEBI:15430) |
| protoporphyrin monomethyl ester (CHEBI:36160) is a dicarboxylic acid monoester (CHEBI:36244) |
| protoporphyrin monomethyl ester (CHEBI:36160) is a protoporphyrins (CHEBI:26361) |
| IUPAC Name |
|---|
| 3-[8,13-diethenyl-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethylporphyrin-2-yl]propanoic acid |
| Synonyms | Source |
|---|---|
| protoporphyrin IX monomethyl ester | ChemIDplus |
| 7,12-diethenyl-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethylporphyrin-2-propanoic acid | JCBN |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4834384 | Reaxys |
| CAS:16053-68-2 | ChemIDplus |