EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OC[C@@H](O)[C@@H]1OC(O)[C@@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a112h-1x_1-4]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2-11H,1H2/t2-,3-,4+,5+,6?/m1/s1 |
| InChIKey | AVVWPBAENSWJCB-QTVWNMPRSA-N |
| Roles Classification |
|---|
| Biological Role: | Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-talofuranose (CHEBI:149542) is a D-talose (CHEBI:28458) |
| D-talofuranose (CHEBI:149542) is enantiomer of L-talofuranose (CHEBI:149539) |
| Incoming Relation(s) |
| α-D-talofuranose (CHEBI:147718) is a D-talofuranose (CHEBI:149542) |
| β-D-talofuranose (CHEBI:148879) is a D-talofuranose (CHEBI:149542) |
| L-talofuranose (CHEBI:149539) is enantiomer of D-talofuranose (CHEBI:149542) |
| IUPAC Names |
|---|
| D-talofuranose |
| Talf |
| Synonyms | Source |
|---|---|
| (3S,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]oxolane-2,3,4-triol | IUPAC |
| D-talo-hexofuranose | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| G78215OT | GlyTouCan |