EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OC[C@@H](O)[C@@H]1O[C@@H](O)[C@@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a1112h-1b_1-4]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2-11H,1H2/t2-,3-,4+,5+,6-/m1/s1 |
| InChIKey | AVVWPBAENSWJCB-RWOPYEJCSA-N |
| Roles Classification |
|---|
| Biological Role: | Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-D-talofuranose (CHEBI:148879) is a D-talofuranose (CHEBI:149542) |
| β-D-talofuranose (CHEBI:148879) is enantiomer of β-L-talofuranose (CHEBI:147529) |
| Incoming Relation(s) |
| β-L-talofuranose (CHEBI:147529) is enantiomer of β-D-talofuranose (CHEBI:148879) |
| IUPAC Names |
|---|
| b-Talf |
| β-D-talofuranose |
| Synonym | Source |
|---|---|
| β-D-talo-hexofuranose | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| G27179LG | GlyTouCan |
| Registry Numbers | Sources |
|---|---|
| CAS:41846-96-2 | PubChem Compound |