EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C8H19N5)n |
| Net Charge | +2 |
| Average Mass | 185.275 |
| Monoisotopic Mass | 185.16295 |
| SMILES | *CCCCCCNC(=[NH2+])NC(=[NH2+])N* |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| polyhexamethylene biguanide(2+) (CHEBI:149538) is a guanidinium ion (CHEBI:60251) |
| polyhexamethylene biguanide(2+) (CHEBI:149538) is conjugate acid of polyhexamethylene biguanide (CHEBI:149520) |
| Incoming Relation(s) |
| polyhexamethylene biguanide hydrochloride (CHEBI:149534) has part polyhexamethylene biguanide(2+) (CHEBI:149538) |
| polyhexamethylene biguanide (CHEBI:149520) is conjugate base of polyhexamethylene biguanide(2+) (CHEBI:149538) |
| IUPAC Name |
|---|
| poly[imino(iminiomethanediyl)imino(iminiomethanediyl)iminohexane-1,6-diyl] |
| Synonym | Source |
|---|---|
| polihexanide(2+) | ChEBI |