EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11N |
| Net Charge | 0 |
| Average Mass | 97.161 |
| Monoisotopic Mass | 97.08915 |
| SMILES | CC1(C)CCC=N1 |
| InChI | InChI=1S/C6H11N/c1-6(2)4-3-5-7-6/h5H,3-4H2,1-2H3 |
| InChIKey | DVPIKQUDWCILSQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | spin trapping reagent A reagent used in electron paramagnetic resonance (EPR) spectroscopy to react covalently with radical products whose half-life is be too short to detect. The resulting adducts are more stable enabling their paramagnetic resonance spectra to be obtained. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,5-dimethyl-1-pyrroline (CHEBI:149492) has role spin trapping reagent (CHEBI:149497) |
| 5,5-dimethyl-1-pyrroline (CHEBI:149492) is a pyrroline (CHEBI:23763) |
| Incoming Relation(s) |
| 5,5-dimethyl-1-pyrroline N-oxide (CHEBI:149489) has functional parent 5,5-dimethyl-1-pyrroline (CHEBI:149492) |
| IUPAC Name |
|---|
| 2,2-dimethyl-3,4-dihydro-2H-pyrrole |
| Manual Xrefs | Databases |
|---|---|
| 9117576 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:2045-76-3 | ChEBI |
| Citations |
|---|