EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| ChEBI ID | CHEBI:149489 |
| ChEBI Name | 5,5-dimethyl-1-pyrroline N-oxide |
| Stars | |
| ASCII Name | 5,5-dimethyl-1-pyrroline N-oxide |
| Definition | A member of the class of 1-pyrroline nitrones (1-pyrroline N-oxides) resulting from the formal N-oxidation of 5,5-dimethyl-1-pyrroline. Used as a spin trap for the study of radicals formed by enzymatic acetaldehyde oxidation. |
| Last Modified | 17 April 2020 |
| Submitter | Gareth Owen |
| Downloads |
| Formula | C6H11NO |
| Net Charge | 0 |
| Average Mass | 113.160 |
| Monoisotopic Mass | 113.08406 |
| SMILES | CC1(C)CCC=[N+]1[O-] |
| InChI | InChI=1S/C6H11NO/c1-6(2)4-3-5-7(6)8/h5H,3-4H2,1-2H3 |
| InChIKey | VCUVETGKTILCLC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. spin trapping reagent A reagent used in electron paramagnetic resonance (EPR) spectroscopy to react covalently with radical products whose half-life is be too short to detect. The resulting adducts are more stable enabling their paramagnetic resonance spectra to be obtained. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,5-dimethyl-1-pyrroline N-oxide (CHEBI:149489) has functional parent 5,5-dimethyl-1-pyrroline (CHEBI:149492) |
| 5,5-dimethyl-1-pyrroline N-oxide (CHEBI:149489) has role neuroprotective agent (CHEBI:63726) |
| 5,5-dimethyl-1-pyrroline N-oxide (CHEBI:149489) has role spin trapping reagent (CHEBI:149497) |
| 5,5-dimethyl-1-pyrroline N-oxide (CHEBI:149489) is a 1-pyrroline nitrones (CHEBI:149491) |
| IUPAC Name |
|---|
| 2,2-dimethyl-3,4-dihydro-2H-pyrrole 1-oxide |
| Synonyms | Source |
|---|---|
| 5,5-dimethyl-1-pyrroline-1-oxide | ChEBI |
| 5,5-dimethyl-1-pyrroline N-oxide | ChemIDplus |
| 5,5-dimethyl-1-pyrroline nitrone | ChEBI |
| 5,5-dimethylpyrroline-N-oxide | ChemIDplus |
| DMPO | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:3317-61-1 | ChemIDplus |
| Citations |
|---|