EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| ChEBI ID | CHEBI:149489 |
| ChEBI Name | 5,5-dimethyl-1-pyrroline N-oxide |
| Stars | |
| ASCII Name | 5,5-dimethyl-1-pyrroline N-oxide |
| Definition | A member of the class of 1-pyrroline nitrones (1-pyrroline N-oxides) resulting from the formal N-oxidation of 5,5-dimethyl-1-pyrroline. Used as a spin trap for the study of radicals formed by enzymatic acetaldehyde oxidation. |
| Last Modified | 17 April 2020 |
| Submitter | Gareth Owen |
| Downloads |
| Formula | C6H11NO |
| Net Charge | 0 |
| Average Mass | 113.160 |
| Monoisotopic Mass | 113.08406 |
| SMILES | CC1(C)CCC=[N+]1[O-] |
| InChI | InChI=1S/C6H11NO/c1-6(2)4-3-5-7(6)8/h5H,3-4H2,1-2H3 |
| InChIKey | VCUVETGKTILCLC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | spin trapping reagent A reagent used in electron paramagnetic resonance (EPR) spectroscopy to react covalently with radical products whose half-life is be too short to detect. The resulting adducts are more stable enabling their paramagnetic resonance spectra to be obtained. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,5-dimethyl-1-pyrroline N-oxide (CHEBI:149489) has functional parent 5,5-dimethyl-1-pyrroline (CHEBI:149492) |
| 5,5-dimethyl-1-pyrroline N-oxide (CHEBI:149489) has role neuroprotective agent (CHEBI:63726) |
| 5,5-dimethyl-1-pyrroline N-oxide (CHEBI:149489) has role spin trapping reagent (CHEBI:149497) |
| 5,5-dimethyl-1-pyrroline N-oxide (CHEBI:149489) is a 1-pyrroline nitrones (CHEBI:149491) |
| IUPAC Name |
|---|
| 2,2-dimethyl-3,4-dihydro-2H-pyrrole 1-oxide |
| Synonyms | Source |
|---|---|
| 5,5-dimethyl-1-pyrroline-1-oxide | ChEBI |
| 5,5-dimethyl-1-pyrroline N-oxide | ChemIDplus |
| 5,5-dimethyl-1-pyrroline nitrone | ChEBI |
| 5,5-dimethylpyrroline-N-oxide | ChemIDplus |
| DMPO | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:3317-61-1 | ChemIDplus |
| Citations |
|---|