EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O5 |
| Net Charge | 0 |
| Average Mass | 298.294 |
| Monoisotopic Mass | 298.08412 |
| SMILES | CC1=C[C@H](O/C=C2/C(=O)O[C@@H]3c4ccccc4C[C@H]23)OC1=O |
| InChI | InChI=1S/C17H14O5/c1-9-6-14(21-16(9)18)20-8-13-12-7-10-4-2-3-5-11(10)15(12)22-17(13)19/h2-6,8,12,14-15H,7H2,1H3/b13-8+/t12-,14-,15-/m1/s1 |
| InChIKey | XHSDUVBUZOUAOQ-WJQMYRPNSA-N |
| Roles Classification |
|---|
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-GR24 (CHEBI:149451) is a (3E)-3-{[(4-methyl-5-oxo-2,5-dihydrofuran-2-yl)oxy]methylidene}-3,3a,4,8b-tetrahydro-2H-indeno[1,2-b]furan-2-one (CHEBI:149462) |
| (+)-GR24 (CHEBI:149451) is a synthetic strigolactone (CHEBI:149458) |
| (+)-GR24 (CHEBI:149451) is enantiomer of (−)-GR24 (CHEBI:149461) |
| Incoming Relation(s) |
| rac-GR24 (CHEBI:149424) has part (+)-GR24 (CHEBI:149451) |
| (−)-GR24 (CHEBI:149461) is enantiomer of (+)-GR24 (CHEBI:149451) |
| IUPAC Name |
|---|
| (3E,3aR,8bS)-3-({[(2R)-4-methyl-5-oxo-2,5-dihydrofuran-2-yl]oxy}methylidene)-3,3a,4,8b-tetrahydro-2H-indeno[1,2-b]furan-2-one |