EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| ChEBI ID | CHEBI:149424 |
| ChEBI Name | rac-GR24 |
| Stars | |
| ASCII Name | rac-GR24 |
| Definition | A racemate comprising equimolar amounts of (+)-GR24 and (−)-GR24. It has been found to inhibit lateral shoot branching (see Nature 2008, v455, 189), stimulate germination of Striga (witchweeds), and aid in the symbiosis of over 80% of terrestrial plants with fungi at arbuscular mycorrihizae in roots. |
| Last Modified | 9 April 2020 |
| Submitter | liviap |
| Downloads |
| Formula | 2C17H14O5 |
| Net Charge | 0 |
| Average Mass | 596.588 |
| Monoisotopic Mass | 596.16825 |
| SMILES | CC1=C[C@@H](O/C=C2/C(=O)O[C@H]3c4ccccc4C[C@@H]23)OC1=O.CC1=C[C@H](O/C=C2/C(=O)O[C@@H]3c4ccccc4C[C@H]23)OC1=O |
| InChI | InChI=1S/2C17H14O5/c2*1-9-6-14(21-16(9)18)20-8-13-12-7-10-4-2-3-5-11(10)15(12)22-17(13)19/h2*2-6,8,12,14-15H,7H2,1H3/b2*13-8+/t2*12-,14-,15-/m10/s1 |
| InChIKey | CYBIPMFQYNGIIF-QRQVFEHCSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rac-GR24 (CHEBI:149424) has part (+)-GR24 (CHEBI:149451) |
| rac-GR24 (CHEBI:149424) has part (−)-GR24 (CHEBI:149461) |
| rac-GR24 (CHEBI:149424) is a racemate (CHEBI:60911) |
| Synonyms | Source |
|---|---|
| AKOS030242765 | SUBMITTER |
| (+/-)-GR24 | ChEBI |
| (±)-GR24 | ChEBI |
| KS-00001G1L | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:76974-79-3 | ChEBI |
| Citations |
|---|