EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OC[C@H](O)[C@H]1OC(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H12O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2-11H,1H2/t2-,3-,4-,5+,6?/m0/s1 |
| InChIKey | AVVWPBAENSWJCB-VSOAQEOCSA-N |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-galactofuranose (CHEBI:149304) is a L-galactose (CHEBI:37618) |
| L-galactofuranose (CHEBI:149304) is enantiomer of D-galactofuranose (CHEBI:143624) |
| Incoming Relation(s) |
| α-L-galactofuranose (CHEBI:148031) is a L-galactofuranose (CHEBI:149304) |
| β-L-galactofuranose (CHEBI:146919) is a L-galactofuranose (CHEBI:149304) |
| D-galactofuranose (CHEBI:143624) is enantiomer of L-galactofuranose (CHEBI:149304) |
| IUPAC Name |
|---|
| L-Galf |
| Synonyms | Source |
|---|---|
| (3S,4S,5R)-5-[(1S)-1,2-dihydroxyethyl]oxolane-2,3,4-triol | IUPAC |
| L-galacto-hexofuranose | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| G32871SU | GlyTouCan |