EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | [H][C@@]1([C@H](O)CO)OC(O)[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a2112h-1x_1-4]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2-11H,1H2/t2-,3-,4-,5+,6?/m1/s1 |
| InChIKey | AVVWPBAENSWJCB-RSVSWTKNSA-N |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). fundamental metabolite Any metabolite produced by all living cells. fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-galactofuranose (CHEBI:143624) is a D-galactose (CHEBI:12936) |
| D-galactofuranose (CHEBI:143624) is enantiomer of L-galactofuranose (CHEBI:149304) |
| Incoming Relation(s) |
| α-D-Glcp-(1→2)-D-Galf (CHEBI:155379) has functional parent D-galactofuranose (CHEBI:143624) |
| β-D-Galf-(1→2)-D-Galf (CHEBI:154861) has functional parent D-galactofuranose (CHEBI:143624) |
| β-D-Galf-(1→3)-D-Galf (CHEBI:152346) has functional parent D-galactofuranose (CHEBI:143624) |
| β-D-Galf-(1→5)-D-Galf (CHEBI:155398) has functional parent D-galactofuranose (CHEBI:143624) |
| β-D-Galp-(1→6)-D-Galf (CHEBI:153660) has functional parent D-galactofuranose (CHEBI:143624) |
| α-D-galactofuranose (CHEBI:146456) is a D-galactofuranose (CHEBI:143624) |
| β-D-galactofuranose (CHEBI:59497) is a D-galactofuranose (CHEBI:143624) |
| β-D-galactofuranosides (CHEBI:231865) is a D-galactofuranose (CHEBI:143624) |
| L-galactofuranose (CHEBI:149304) is enantiomer of D-galactofuranose (CHEBI:143624) |
| IUPAC Name |
|---|
| D-galactofuranose |
| Synonyms | Source |
|---|---|
| D-Galf | ChEBI |
| D-GalfOH | ChEBI |
| D-galacto-hexofuranose | IUPAC |
| UniProt Name | Source |
|---|---|
| D-galactofuranose | UniProt |
| Citations |
|---|