EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31ClO5 |
| Net Charge | 0 |
| Average Mass | 422.949 |
| Monoisotopic Mass | 422.18600 |
| SMILES | [H][C@@]1(/C(C)=C/CC/C(C)=C/Cc2c(O)c(Cl)c(C)c(C=O)c2O)C[C@H](O)C(C)(C)O1 |
| InChI | InChI=1S/C23H31ClO5/c1-13(7-6-8-14(2)18-11-19(26)23(4,5)29-18)9-10-16-21(27)17(12-25)15(3)20(24)22(16)28/h8-9,12,18-19,26-28H,6-7,10-11H2,1-5H3/b13-9+,14-8+/t18-,19-/m0/s1 |
| InChIKey | YHXSUSPTGLHIRR-UZFWGDPLSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascofuranol (CHEBI:146279) is a dihydroxybenzaldehyde (CHEBI:50196) |
| ascofuranol (CHEBI:146279) is a meroterpenoid (CHEBI:64419) |
| ascofuranol (CHEBI:146279) is a monochlorobenzenes (CHEBI:83403) |
| ascofuranol (CHEBI:146279) is a monohydroxytetrahydrofuran (CHEBI:47018) |
| ascofuranol (CHEBI:146279) is a olefinic compound (CHEBI:78840) |
| ascofuranol (CHEBI:146279) is a resorcinols (CHEBI:33572) |
| ascofuranol (CHEBI:146279) is a sesquiterpenoid (CHEBI:26658) |
| ascofuranol (CHEBI:146279) is conjugate acid of ascofuranol(1−) (CHEBI:146159) |
| Incoming Relation(s) |
| ascofuranol(1−) (CHEBI:146159) is conjugate base of ascofuranol (CHEBI:146279) |
| IUPAC Name |
|---|
| 3-chloro-4,6-dihydroxy-5-{(2E,6E)-7-[(2S,4S)-4-hydroxy-5,5-dimethyltetrahydrofuran-2-yl]-3-methylocta-2,6-dien-1-yl}-2-methylbenzaldehyde |
| Synonyms | Source |
|---|---|
| (2S-(2α(2E,6E),4α))-3-chloro-4,6-dihydroxy-2-methyl-5-(3-methyl-7-(tetrahydro-4-hydroxy-5,5-dimethyl-2-furanyl)-2,6-octadienyl)-benzaldehyde | ChemIDplus |
| (−)-ascofuranol | ChEBI |
| (2'E,6'E,1'S,4'S )-(−)-5-chloro-2,4-dihydroxy-6-methyl-3-[7'-(3',3'-dimethyl-4'-hydroxy-2'-oxacyclopentyl)-3',7'-dimethyl-2',6'-hepta-dienyl]benzaldehyde | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00017974 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:51759-79-6 | ChemIDplus |
| Citations |
|---|