EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30ClO5 |
| Net Charge | -1 |
| Average Mass | 421.941 |
| Monoisotopic Mass | 421.17873 |
| SMILES | [H][C@@]1(/C(C)=C/CC/C(C)=C/Cc2c([O-])c(Cl)c(C)c(C=O)c2O)C[C@H](O)C(C)(C)O1 |
| InChI | InChI=1S/C23H31ClO5/c1-13(7-6-8-14(2)18-11-19(26)23(4,5)29-18)9-10-16-21(27)17(12-25)15(3)20(24)22(16)28/h8-9,12,18-19,26-28H,6-7,10-11H2,1-5H3/p-1/b13-9+,14-8+/t18-,19-/m0/s1 |
| InChIKey | YHXSUSPTGLHIRR-UZFWGDPLSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascofuranol(1−) (CHEBI:146159) is a phenolate anion (CHEBI:50525) |
| ascofuranol(1−) (CHEBI:146159) is conjugate base of ascofuranol (CHEBI:146279) |
| Incoming Relation(s) |
| ascofuranol (CHEBI:146279) is conjugate acid of ascofuranol(1−) (CHEBI:146159) |
| UniProt Name | Source |
|---|---|
| ascofuranol | UniProt |
| Citations |
|---|