EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29N2O3 |
| Net Charge | +1 |
| Average Mass | 369.485 |
| Monoisotopic Mass | 369.21727 |
| SMILES | [H][C@]12C[C@H](CC)[C@]3([H])[NH+](CCc4c(nc5ccc(OC)cc45)[C@]3(C(=O)OC)C1)C2 |
| InChI | InChI=1S/C22H28N2O3/c1-4-14-9-13-11-22(21(25)27-3)19-16(7-8-24(12-13)20(14)22)17-10-15(26-2)5-6-18(17)23-19/h5-6,10,13-14,20,23H,4,7-9,11-12H2,1-3H3/p+1/t13-,14-,20-,22+/m0/s1 |
| InChIKey | MMAYTCMMKJYIAM-RUGRQLENSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-voacangine(1+) (CHEBI:146230) is a ammonium ion derivative (CHEBI:35274) |
| (−)-voacangine(1+) (CHEBI:146230) is conjugate acid of (−)-voacangine (CHEBI:141966) |
| Incoming Relation(s) |
| (−)-voacangine (CHEBI:141966) is conjugate base of (−)-voacangine(1+) (CHEBI:146230) |
| IUPAC Name |
|---|
| (6ξ)-12-methoxy-18-(methoxycarbonyl)-2α-ibogamin-6-ium |
| UniProt Name | Source |
|---|---|
| (−)-voacangine | UniProt |
| Citations |
|---|