EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N2O3 |
| Net Charge | 0 |
| Average Mass | 368.477 |
| Monoisotopic Mass | 368.20999 |
| SMILES | [H][C@]12C[C@H](CC)[C@]3([H])N(CCc4c(nc5ccc(OC)cc45)[C@]3(C(=O)OC)C1)C2 |
| InChI | InChI=1S/C22H28N2O3/c1-4-14-9-13-11-22(21(25)27-3)19-16(7-8-24(12-13)20(14)22)17-10-15(26-2)5-6-18(17)23-19/h5-6,10,13-14,20,23H,4,7-9,11-12H2,1-3H3/t13-,14-,20-,22+/m0/s1 |
| InChIKey | MMAYTCMMKJYIAM-RUGRQLENSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ervatamia pandacaqui (IPNI:78961-1) | leaf (BTO:0000713) | PubMed (29728039) | |
| Ervatamia yunnanensis (IPNI:78987-1) | stem (BTO:0001300) | PubMed (19647051) | |
| Tabernaemontana alba (ncbitaxon:761051) | bark (BTO:0001301) | PubMed (27448833) | |
| Tabernaemontana arborea (ncbitaxon:681494) | bark (BTO:0001301) | PubMed (27448833) | |
| Tabernaemontana catharinensis (ncbitaxon:403124) | - | Article (Pereira, C.G., Carvalho, J.E. and Meireles, M.A.A. Anticancer activity of Tabernaemontana catharinensis extract obtained by supercritical fluid extraction (2006). Rev. Bras. Pl. Med., Botucatu, 8(4), p 144–149.) | |
| Tabernaemontana divaricata (ncbitaxon:52861) | flower (BTO:0000469) | PubMed (29883785) | |
| Tabernaemontana psorocarpa (ncbitaxon:761091) | bark (BTO:0001301) | PubMed (17405098) | |
| Trachelospermum jasminoides (ncbitaxon:69389) | leaf (BTO:0000713) | PubMed (17268963) | |
| Voacanga africana (ncbitaxon:141630) | |||
| bark (BTO:0001301) | PubMed (26140390) | ||
| bark (BTO:0001301) | PubMed (24484240) | ||
| Voacanga schweinfurthii (ncbitaxon:1239737) | - | PubMed (14254313) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-voacangine (CHEBI:141966) has role angiogenesis inhibitor (CHEBI:48422) |
| (−)-voacangine (CHEBI:141966) has role antineoplastic agent (CHEBI:35610) |
| (−)-voacangine (CHEBI:141966) has role plant metabolite (CHEBI:76924) |
| (−)-voacangine (CHEBI:141966) is a alkaloid ester (CHEBI:38481) |
| (−)-voacangine (CHEBI:141966) is a methyl ester (CHEBI:25248) |
| (−)-voacangine (CHEBI:141966) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| (−)-voacangine (CHEBI:141966) is a organic heteropentacyclic compound (CHEBI:38164) |
| (−)-voacangine (CHEBI:141966) is a tertiary amino compound (CHEBI:50996) |
| (−)-voacangine (CHEBI:141966) is conjugate base of (−)-voacangine(1+) (CHEBI:146230) |
| Incoming Relation(s) |
| (−)-voacangine(1+) (CHEBI:146230) is conjugate acid of (−)-voacangine (CHEBI:141966) |
| IUPAC Name |
|---|
| methyl (6ξ)-12-methoxy-2α-ibogamine-18-carboxylate |
| Synonyms | Source |
|---|---|
| 12-methoxyibogamine-18-carboxylic acid methyl ester | ChEBI |
| carbomethoxyibogaine | KNApSAcK |
| (−)-voacangine | KNApSAcK |
| voacangine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00025223 | KNApSAcK |
| US2013211073 | Patent |
| Voacangine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:55361 | Reaxys |
| CAS:510-22-5 | KNApSAcK |
| CAS:510-22-5 | ChemIDplus |
| Citations |
|---|