EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H36O2 |
| Net Charge | 0 |
| Average Mass | 284.484 |
| Monoisotopic Mass | 284.27153 |
| SMILES | CCCCCCCCCCCCCCCCOC(C)=O |
| InChI | InChI=1S/C18H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18(2)19/h3-17H2,1-2H3 |
| InChIKey | LSTDYDRCKUBPDI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. |
| Application: | cosmetic The role played by a substance in enhancing the appearance or odour of the human body; a name given to the substance itself or to a component of it. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| palmityl acetate (CHEBI:146185) has functional parent hexadecan-1-ol (CHEBI:16125) |
| palmityl acetate (CHEBI:146185) has role cosmetic (CHEBI:64857) |
| palmityl acetate (CHEBI:146185) has role epitope (CHEBI:53000) |
| palmityl acetate (CHEBI:146185) has role pheromone (CHEBI:26013) |
| palmityl acetate (CHEBI:146185) is a acetate ester (CHEBI:47622) |
| IUPAC Name |
|---|
| hexadecyl acetate |
| Synonyms | Source |
|---|---|
| 1-acetoxyhexadecane | ChemIDplus |
| 1-hexadecanol, acetate | ChemIDplus |
| cetyl acetate | ChemIDplus |
| n-hexadecyl ethanoate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| US2003162781 | Patent |
| US5372742 | Patent |
| US6673836 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1782695 | Beilstein |
| CAS:629-70-9 | ChemIDplus |
| Citations |
|---|