EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| ChEBI ID | CHEBI:146016 |
| ChEBI Name | (P)-viriditoxin |
| Stars | |
| ASCII Name | (P)-viriditoxin |
| Definition | A dimethyl 2,2'-(9,9',10,10'-tetrahydroxy-7,7'-dimethoxy-1,1'-dioxo-3,3',4,4'-tetrahydro-[6,6'-binaphtho[2,3-c]pyran]-3,3'-diyl)diacetate in which the the 3 and 3' positions (bearing the 2-methoxy-2-oxoethyl (CH2CO2Me) groups) both have S configuration, while the 6 and 6' positions (where the binaphthopyran units are linked) have Sa configuration (the P atropisomer). It is found in trace amounts (with much greater amounts of the M atropisomer) in the fungus Paecilomyces variotii derived from the inner tissues of the giant jellyfish Nemopilema nomurai. |
| Last Modified | 6 February 2020 |
| Submitter | Gareth Owen |
| Downloads |
| Formula | C34H30O14 |
| Net Charge | 0 |
| Average Mass | 662.600 |
| Monoisotopic Mass | 662.16356 |
| SMILES | COC(=O)C[C@@H]1Cc2cc3c(-c4c(OC)cc(O)c5c(O)c6c(cc45)C[C@@H](CC(=O)OC)OC6=O)c(OC)cc(O)c3c(O)c2C(=O)O1 |
| InChI | InChI=1S/C34H30O14/c1-43-21-11-19(35)27-17(7-13-5-15(9-23(37)45-3)47-33(41)25(13)31(27)39)29(21)30-18-8-14-6-16(10-24(38)46-4)48-34(42)26(14)32(40)28(18)20(36)12-22(30)44-2/h7-8,11-12,15-16,35-36,39-40H,5-6,9-10H2,1-4H3/t15-,16-/m0/s1 |
| InChIKey | GMCZVCXZGZGZPX-HOTGVXAUSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (P)-viriditoxin (CHEBI:146016) has functional parent semiviriditoxin (CHEBI:146008) |
| (P)-viriditoxin (CHEBI:146016) is a dimethyl 2,2'-(9,9',10,10'-tetrahydroxy-7,7'-dimethoxy-1,1'-dioxo-3,3',4,4'-tetrahydro-[6,6'-binaphtho[2,3-c]pyran]-3,3'-diyl)diacetate (CHEBI:146015) |
| IUPAC Name |
|---|
| dimethyl 2,2'-[(3S,3'S,6Sa)-9,9',10,10'-tetrahydroxy-7,7'-dimethoxy-1,1'-dioxo-3,3',4,4'-tetrahydro-1H,1'H-[6,6'-binaphtho[2,3-c]pyran]-3,3'-diyl]diacetate |
| Citations |
|---|