EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O7 |
| Net Charge | 0 |
| Average Mass | 332.308 |
| Monoisotopic Mass | 332.08960 |
| SMILES | COC(=O)C[C@@H]1Cc2cc3cc(OC)cc(O)c3c(O)c2C(=O)O1 |
| InChI | InChI=1S/C17H16O7/c1-22-10-4-8-3-9-5-11(7-13(19)23-2)24-17(21)15(9)16(20)14(8)12(18)6-10/h3-4,6,11,18,20H,5,7H2,1-2H3/t11-/m0/s1 |
| InChIKey | CVDVPYTVGZWTON-NSHDSACASA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| semiviriditoxin (CHEBI:146008) has role fungal metabolite (CHEBI:76946) |
| semiviriditoxin (CHEBI:146008) is a heptaketide (CHEBI:59872) |
| semiviriditoxin (CHEBI:146008) is a methyl ester (CHEBI:25248) |
| semiviriditoxin (CHEBI:146008) is a naphtho-α-pyrone (CHEBI:146280) |
| semiviriditoxin (CHEBI:146008) is a phenols (CHEBI:33853) |
| semiviriditoxin (CHEBI:146008) is a δ-lactone (CHEBI:18946) |
| Incoming Relation(s) |
| (M)-viriditoxin (CHEBI:146007) has functional parent semiviriditoxin (CHEBI:146008) |
| (P)-viriditoxin (CHEBI:146016) has functional parent semiviriditoxin (CHEBI:146008) |
| IUPAC Name |
|---|
| methyl [(3S)-9,10-dihydroxy-7-methoxy-1-oxo-3,4-dihydro-1H-naphtho[2,3-c]pyran-3-yl]acetate |
| UniProt Name | Source |
|---|---|
| semiviriditoxin | UniProt |
| Citations |
|---|