EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18O8 |
| Net Charge | 0 |
| Average Mass | 410.378 |
| Monoisotopic Mass | 410.10017 |
| SMILES | COc1cc(=O)oc2cc(O)c(-c3c(O)cc(C)c4c(OC)cc(=O)oc34)c(C)c12 |
| InChI | InChI=1S/C22H18O8/c1-9-5-11(23)21(22-18(9)13(27-3)7-17(26)30-22)19-10(2)20-14(28-4)8-16(25)29-15(20)6-12(19)24/h5-8,23-24H,1-4H3 |
| InChIKey | PRMZXICFBUXBCX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Emericella desertorum (ncbitaxon:1810909) | - | PubMed (26389790) | Strain: CBS 653.73 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desertorin A (CHEBI:146002) has role Aspergillus metabolite (CHEBI:76956) |
| desertorin A (CHEBI:146002) is a bicoumarin (CHEBI:64461) |
| desertorin A (CHEBI:146002) is conjugate acid of desertorin A(1−) (CHEBI:145993) |
| Incoming Relation(s) |
| desertorin A(1−) (CHEBI:145993) is conjugate base of desertorin A (CHEBI:146002) |
| IUPAC Name |
|---|
| 7,7'-dihydroxy-4,4'-dimethoxy-5,5'-dimethyl-2H,2'H-[6,8'-bichromene]-2,2'-dione |
| Synonyms | Source |
|---|---|
| 7,7'-dihydroxy-4,4'-dimethoxy-5,5'-dimethyl-2H,2'H-[6,8'-bi-1-benzopyran]-2,2'-dione | IUPAC |
| M-desertorin A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:110325-63-8 | ChEBI |
| Citations |
|---|