EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H17O8 |
| Net Charge | -1 |
| Average Mass | 409.370 |
| Monoisotopic Mass | 409.09289 |
| SMILES | COc1cc(=O)oc2cc([O-])c(-c3c(O)cc(C)c4c(OC)cc(=O)oc34)c(C)c12 |
| InChI | InChI=1S/C22H18O8/c1-9-5-11(23)21(22-18(9)13(27-3)7-17(26)30-22)19-10(2)20-14(28-4)8-16(25)29-15(20)6-12(19)24/h5-8,23-24H,1-4H3/p-1 |
| InChIKey | PRMZXICFBUXBCX-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desertorin A(1−) (CHEBI:145993) is a phenolate anion (CHEBI:50525) |
| desertorin A(1−) (CHEBI:145993) is conjugate base of desertorin A (CHEBI:146002) |
| Incoming Relation(s) |
| desertorin A (CHEBI:146002) is conjugate acid of desertorin A(1−) (CHEBI:145993) |
| Synonyms | Source |
|---|---|
| desertorin A anion | ChEBI |
| M-desertorin A(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| desertorin A | UniProt |
| Citations |
|---|