EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H38O2 |
| Net Charge | 0 |
| Average Mass | 346.555 |
| Monoisotopic Mass | 346.28718 |
| SMILES | CCCCCCCCCCCCCCCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18-21-25-23(24)22-19-16-15-17-20-22/h15-17,19-20H,2-14,18,21H2,1H3 |
| InChIKey | RAMRROOXFMYSNA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhodococcus rhodochrous (ncbitaxon:1829) | - | PubMed (19125399) |
| Roles Classification |
|---|
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexadecyl benzoate (CHEBI:145972) has functional parent benzoic acid (CHEBI:30746) |
| hexadecyl benzoate (CHEBI:145972) has functional parent hexadecan-1-ol (CHEBI:16125) |
| hexadecyl benzoate (CHEBI:145972) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| hexadecyl benzoate (CHEBI:145972) is a benzoate ester (CHEBI:36054) |
| IUPAC Name |
|---|
| hexadecyl benzoate |
| Synonyms | Source |
|---|---|
| benzoic acid hexadecyl ester | ChEBI |
| cetyl benzoate | ChemIDplus |
| benzoic acid cetyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0094685 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:22485-54-7 | ChemIDplus |
| Citations |
|---|