EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO |
| Net Charge | 0 |
| Average Mass | 163.220 |
| Monoisotopic Mass | 163.09971 |
| SMILES | CN[C@@H](C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C10H13NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,11H,1-2H3/t8-/m0/s1 |
| InChIKey | LPLLVINFLBSFRP-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-methcathinone (CHEBI:145808) is a 2-methylamino-1-phenylpropan-1-one (CHEBI:149677) |
| (S)-methcathinone (CHEBI:145808) is conjugate base of (S)-methcathinone(1+) (CHEBI:145731) |
| (S)-methcathinone (CHEBI:145808) is enantiomer of (R)-methcathinone (CHEBI:149678) |
| Incoming Relation(s) |
| methcathinone (CHEBI:149681) has part (S)-methcathinone (CHEBI:145808) |
| (S)-methcathinone(1+) (CHEBI:145731) is conjugate acid of (S)-methcathinone (CHEBI:145808) |
| (R)-methcathinone (CHEBI:149678) is enantiomer of (S)-methcathinone (CHEBI:145808) |
| IUPAC Name |
|---|
| (2S)-2-(methylamino)-1-phenylpropan-1-one |
| Synonyms | Source |
|---|---|
| (2S)-1-phenyl-2-(methylamino)-1-propanone | ChEBI |
| (S)-1-phenyl-1-oxo-2-methylaminopropane | ChEBI |
| (S)-2-methylamino-1-phenylpropan-1-one | ChEBI |
| (S)-(−)-methcathinone | ChEBI |
| (−)-methcathinone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C22263 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:112117-24-5 | ChemIDplus |
| Citations |
|---|