EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14NO |
| Net Charge | +1 |
| Average Mass | 164.228 |
| Monoisotopic Mass | 164.10699 |
| SMILES | C[NH2+][C@@H](C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C10H13NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,11H,1-2H3/p+1/t8-/m0/s1 |
| InChIKey | LPLLVINFLBSFRP-QMMMGPOBSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-methcathinone(1+) (CHEBI:145731) is a ammonium ion derivative (CHEBI:35274) |
| (S)-methcathinone(1+) (CHEBI:145731) is conjugate acid of (S)-methcathinone (CHEBI:145808) |
| (S)-methcathinone(1+) (CHEBI:145731) is enantiomer of (R)-methcathinone(1+) (CHEBI:149676) |
| Incoming Relation(s) |
| (S)-methcathinone (CHEBI:145808) is conjugate base of (S)-methcathinone(1+) (CHEBI:145731) |
| (R)-methcathinone(1+) (CHEBI:149676) is enantiomer of (S)-methcathinone(1+) (CHEBI:145731) |
| IUPAC Name |
|---|
| (2S)-N-methyl-1-oxo-1-phenylpropan-2-aminium |
| Synonyms | Source |
|---|---|
| (S)-N-methyl-1-oxo-1-phenylpropan-2-aminium | ChEBI |
| methyl-[(2S)-1-oxo-1-phenylpropan-2-yl]azanium | ChEBI |
| UniProt Name | Source |
|---|---|
| (S)-2-methylamino-1-phenylpropan-1-one | UniProt |