EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N2O3 |
| Net Charge | 0 |
| Average Mass | 248.282 |
| Monoisotopic Mass | 248.11609 |
| SMILES | COc1ccc2nc(O)c(CCNC(C)=O)c2c1 |
| InChI | InChI=1S/C13H16N2O3/c1-8(16)14-6-5-10-11-7-9(18-2)3-4-12(11)15-13(10)17/h3-4,7,15,17H,5-6H2,1-2H3,(H,14,16) |
| InChIKey | CIEAUFSGHUWAMC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxymelatonin (CHEBI:145792) has functional parent melatonin (CHEBI:16796) |
| 2-hydroxymelatonin (CHEBI:145792) has role antineoplastic agent (CHEBI:35610) |
| 2-hydroxymelatonin (CHEBI:145792) has role apoptosis inducer (CHEBI:68495) |
| 2-hydroxymelatonin (CHEBI:145792) has role plant metabolite (CHEBI:76924) |
| 2-hydroxymelatonin (CHEBI:145792) is a acetamides (CHEBI:22160) |
| 2-hydroxymelatonin (CHEBI:145792) is a hydroxyindoles (CHEBI:84729) |
| 2-hydroxymelatonin (CHEBI:145792) is a tryptamines (CHEBI:27162) |
| IUPAC Name |
|---|
| N-[2-(2-hydroxy-5-methoxy-1H-indol-3-yl)ethyl]acetamide |
| Synonym | Source |
|---|---|
| 2-OHMT | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-hydroxymelatonin | UniProt |
| Citations |
|---|