EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H38O17 |
| Net Charge | 0 |
| Average Mass | 694.639 |
| Monoisotopic Mass | 694.21090 |
| SMILES | [H][C@]12CO[C@H](c3cc4c(cc3O[C@@H]3O[C@H](CO[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@H]3O)OCO4)[C@@]1([H])CO[C@@H]2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C32H38O17/c33-6-21-23(34)25(36)27(38)31(48-21)42-9-22-24(35)26(37)28(39)32(49-22)47-17-5-20-19(45-11-46-20)4-13(17)30-15-8-40-29(14(15)7-41-30)12-1-2-16-18(3-12)44-10-43-16/h1-5,14-15,21-39H,6-11H2/t14-,15-,21+,22+,23+,24+,25-,26-,27+,28+,29+,30+,31+,32+/m0/s1 |
| InChIKey | YIGQNWGFLQZODP-SFMWUWOUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sesamum indicum (ncbitaxon:4182) | seed (BTO:0001226) | PubMed (18248594) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sesaminol 2-O-β-D-gentiobioside (CHEBI:145785) has functional parent sesaminol (CHEBI:145778) |
| sesaminol 2-O-β-D-gentiobioside (CHEBI:145785) has role plant metabolite (CHEBI:76924) |
| sesaminol 2-O-β-D-gentiobioside (CHEBI:145785) is a benzodioxoles (CHEBI:38298) |
| sesaminol 2-O-β-D-gentiobioside (CHEBI:145785) is a disaccharide derivative (CHEBI:63353) |
| sesaminol 2-O-β-D-gentiobioside (CHEBI:145785) is a furofuran (CHEBI:47790) |
| sesaminol 2-O-β-D-gentiobioside (CHEBI:145785) is a gentiobioside (CHEBI:24215) |
| IUPAC Name |
|---|
| 6-[(1S,3aR,4S,6aR)-4-(1,3-benzodioxol-5-yl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-1,3-benzodioxol-5-yl 6-O-β-D-glucopyranosyl-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| (+)-sesaminol 2-O-β-D-gentiobioside | MetaCyc |
| (+)-sesaminol 2-O-β-D-glucosyl (1→6)-O-β-D-glucoside | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-14839 | MetaCyc |
| Citations |
|---|