EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O7 |
| Net Charge | 0 |
| Average Mass | 370.357 |
| Monoisotopic Mass | 370.10525 |
| SMILES | [H][C@]12CO[C@H](c3cc4c(cc3O)OCO4)[C@@]1([H])CO[C@@H]2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H18O7/c21-14-5-18-17(26-9-27-18)4-11(14)20-13-7-22-19(12(13)6-23-20)10-1-2-15-16(3-10)25-8-24-15/h1-5,12-13,19-21H,6-9H2/t12-,13-,19+,20+/m0/s1 |
| InChIKey | KQRXQIPRDKVZPW-ISZNXKAUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sesamum indicum (ncbitaxon:4182) | seed (PO:0009010) | PubMed (18248594) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sesaminol (CHEBI:145778) has role antioxidant (CHEBI:22586) |
| sesaminol (CHEBI:145778) has role plant metabolite (CHEBI:76924) |
| sesaminol (CHEBI:145778) is a benzodioxoles (CHEBI:38298) |
| sesaminol (CHEBI:145778) is a furofuran (CHEBI:47790) |
| sesaminol (CHEBI:145778) is a organic hydroxy compound (CHEBI:33822) |
| Incoming Relation(s) |
| sesaminol 2-O-β-D-gentiobioside (CHEBI:145785) has functional parent sesaminol (CHEBI:145778) |
| sesaminol 2-O-β-D-glucoside (CHEBI:145784) has functional parent sesaminol (CHEBI:145778) |
| IUPAC Name |
|---|
| 6-[(1S,3aR,4S,6aR)-4-(1,3-benzodioxol-5-yl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-1,3-benzodioxol-5-ol |
| Synonyms | Source |
|---|---|
| (+)-sesaminol | MetaCyc |
| (1S-(1α,3aα,4α,6aα))-6-(4-(1,3-benzodioxol-5-yl)tetrahydro-1H,3H-furo(3,4-c)furan-1-yl)-1,3-benzodioxol-5-ol | ChemIDplus |
| justisolin | HMDB |
| Manual Xrefs | Databases |
|---|---|
| CPD-14837 | MetaCyc |
| FDB018404 | FooDB |
| HMDB0038932 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:74061-79-3 | ChemIDplus |
| Citations |
|---|