EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O15 |
| Net Charge | 0 |
| Average Mass | 594.522 |
| Monoisotopic Mass | 594.15847 |
| SMILES | O=c1c(-c2ccc(O)cc2)coc2cc(O[C@@H]3O[C@H](CO[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@@H](O)[C@H](O)[C@H]3O)cc(O)c12 |
| InChI | InChI=1S/C27H30O15/c28-7-16-20(32)22(34)24(36)26(41-16)39-9-17-21(33)23(35)25(37)27(42-17)40-12-5-14(30)18-15(6-12)38-8-13(19(18)31)10-1-3-11(29)4-2-10/h1-6,8,16-17,20-30,32-37H,7,9H2/t16-,17-,20-,21-,22+,23+,24-,25-,26-,27-/m1/s1 |
| InChIKey | YKBIHKIVJICDCU-UMUUNPGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apios americana (ncbitaxon:185702) | - | PubMed (23265491) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| genistin 7-O-gentiobioside (CHEBI:145776) has functional parent genistein (CHEBI:28088) |
| genistin 7-O-gentiobioside (CHEBI:145776) has role plant metabolite (CHEBI:76924) |
| genistin 7-O-gentiobioside (CHEBI:145776) is a disaccharide derivative (CHEBI:63353) |
| genistin 7-O-gentiobioside (CHEBI:145776) is a gentiobioside (CHEBI:24215) |
| genistin 7-O-gentiobioside (CHEBI:145776) is a glycosyloxyisoflavone (CHEBI:74630) |
| genistin 7-O-gentiobioside (CHEBI:145776) is a hydroxyisoflavone (CHEBI:38755) |
| IUPAC Name |
|---|
| 5-hydroxy-3-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl 6-O-β-D-glucopyranosyl-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 5-hydroxy-3-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-7-yl 6-O-β-D-glucopyranosyl-β-D-glucopyranoside | IUPAC |
| genistein 7-O-gentiobioside | MetaCyc |
| genistein-7-O-gentiobioside | ChEBI |
| genistein 7-gentiobioside | ChEBI |
| genistin 7-gentiobioside | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-14848 | MetaCyc |
| Citations |
|---|