EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29O8P |
| Net Charge | 0 |
| Average Mass | 440.429 |
| Monoisotopic Mass | 440.16000 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)COP(=O)(O)O)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C21H29O8P/c1-19-7-5-13(22)9-12(19)3-4-14-15-6-8-21(25,17(24)11-29-30(26,27)28)20(15,2)10-16(23)18(14)19/h5,7,9,14-16,18,23,25H,3-4,6,8,10-11H2,1-2H3,(H2,26,27,28)/t14-,15-,16-,18+,19-,20-,21-/m0/s1 |
| InChIKey | JDOZJEUDSLGTLU-VWUMJDOOSA-N |
| Roles Classification |
|---|
| Biological Roles: | glucocorticoid receptor agonist An agonist that selectively binds to and activates a glucocorticoid receptor. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prednisolone phosphate (CHEBI:145705) has functional parent prednisolone (CHEBI:8378) |
| prednisolone phosphate (CHEBI:145705) has role anti-inflammatory agent (CHEBI:67079) |
| prednisolone phosphate (CHEBI:145705) has role antineoplastic agent (CHEBI:35610) |
| prednisolone phosphate (CHEBI:145705) has role glucocorticoid receptor agonist (CHEBI:63562) |
| prednisolone phosphate (CHEBI:145705) has role prodrug (CHEBI:50266) |
| prednisolone phosphate (CHEBI:145705) is a 11β-hydroxy steroid (CHEBI:35346) |
| prednisolone phosphate (CHEBI:145705) is a 17α-hydroxy steroid (CHEBI:35342) |
| prednisolone phosphate (CHEBI:145705) is a 20-oxo steroid (CHEBI:36885) |
| prednisolone phosphate (CHEBI:145705) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| prednisolone phosphate (CHEBI:145705) is a glucocorticoid (CHEBI:24261) |
| prednisolone phosphate (CHEBI:145705) is a steroid phosphate (CHEBI:36944) |
| prednisolone phosphate (CHEBI:145705) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| prednisolone phosphate (CHEBI:145705) is conjugate acid of prednisolone phosphate(2−) (CHEBI:145706) |
| Incoming Relation(s) |
| prednisolone phosphate(2−) (CHEBI:145706) is conjugate base of prednisolone phosphate (CHEBI:145705) |
| IUPAC Name |
|---|
| 11β,17-dihydroxy-3,20-dioxopregna-1,4-dien-21-yl dihydrogen phosphate |
| Synonyms | Source |
|---|---|
| prednisolone 21-(dihydrogen phosphate) | ChemIDplus |
| prednisolone 21-monophosphate | DrugBank |
| prednisolone 21-phosphate | DrugBank |
| Citations |
|---|