EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N6O6S |
| Net Charge | 0 |
| Average Mass | 410.412 |
| Monoisotopic Mass | 410.10085 |
| SMILES | CCOc1nc(NC)nc(NC(=O)NS(=O)(=O)c2ccccc2C(=O)OC)n1 |
| InChI | InChI=1S/C15H18N6O6S/c1-4-27-15-19-12(16-2)17-13(20-15)18-14(23)21-28(24,25)10-8-6-5-7-9(10)11(22)26-3/h5-8H,4H2,1-3H3,(H3,16,17,18,19,20,21,23) |
| InChIKey | ZINJLDJMHCUBIP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.2.1.6 (acetolactate synthase) inhibitor An EC 2.2.1.* (transketolase/transaldolase) inhibitor that interferes with the action of acetolactate synthase (EC 2.2.1.6). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethametsulfuron-methyl (CHEBI:145553) has functional parent ethametsulfuron (CHEBI:145551) |
| ethametsulfuron-methyl (CHEBI:145553) has role EC 2.2.1.6 (acetolactate synthase) inhibitor (CHEBI:22180) |
| ethametsulfuron-methyl (CHEBI:145553) has role herbicide (CHEBI:24527) |
| ethametsulfuron-methyl (CHEBI:145553) is a N-sulfonylurea (CHEBI:76983) |
| ethametsulfuron-methyl (CHEBI:145553) is a aromatic ether (CHEBI:35618) |
| ethametsulfuron-methyl (CHEBI:145553) is a benzoate ester (CHEBI:36054) |
| ethametsulfuron-methyl (CHEBI:145553) is a diamino-1,3,5-triazine (CHEBI:38170) |
| ethametsulfuron-methyl (CHEBI:145553) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| methyl 2-({[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]carbamoyl}sulfamoyl)benzoate |
| Synonyms | Source |
|---|---|
| DPX-A7881 | PPDB |
| methyl 2-[[[[[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]amino]carbonyl]amino]sulfonyl]benzoate | Alan Wood's Pesticides |
| methyl 2-[(4-ethoxy-6-methylamino-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoate | ChEBI |
| ethametsulfuron methyl | ChEBI |
| Brand Names | Source |
|---|---|
| Muster | ChEBI |
| Salsa | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| derivatives/ethametsulfuron-methyl | Alan Wood's Pesticides |
| 1146 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8165260 | Reaxys |
| CAS:97780-06-8 | ChemIDplus |
| Citations |
|---|