EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N6O6S |
| Net Charge | 0 |
| Average Mass | 396.385 |
| Monoisotopic Mass | 396.08520 |
| SMILES | CCOc1nc(NC)nc(NC(=O)NS(=O)(=O)c2ccccc2C(=O)O)n1 |
| InChI | InChI=1S/C14H16N6O6S/c1-3-26-14-18-11(15-2)16-12(19-14)17-13(23)20-27(24,25)9-7-5-4-6-8(9)10(21)22/h4-7H,3H2,1-2H3,(H,21,22)(H3,15,16,17,18,19,20,23) |
| InChIKey | IRLGCAJYYKDTCG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethametsulfuron (CHEBI:145551) has role herbicide (CHEBI:24527) |
| ethametsulfuron (CHEBI:145551) is a N-sulfonylurea (CHEBI:76983) |
| ethametsulfuron (CHEBI:145551) is a aromatic ether (CHEBI:35618) |
| ethametsulfuron (CHEBI:145551) is a benzoic acids (CHEBI:22723) |
| ethametsulfuron (CHEBI:145551) is a diamino-1,3,5-triazine (CHEBI:38170) |
| Incoming Relation(s) |
| ethametsulfuron-methyl (CHEBI:145553) has functional parent ethametsulfuron (CHEBI:145551) |
| IUPAC Name |
|---|
| 2-({[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]carbamoyl}sulfamoyl)benzoic acid |
| Synonyms | Source |
|---|---|
| 2-[[[[[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]amino]carbonyl]amino]sulfonyl]benzoic acid | Alan Wood's Pesticides |
| 1-[(2-carboxyphenyl)sulfonyl]-3-[4-(methylamino)-6-ethoxy-1,3,5-triazine-2-yl]urea | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| ethametsulfuron | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8797661 | Reaxys |
| CAS:111353-84-5 | ChemIDplus |
| Citations |
|---|