EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H36O2 |
| Net Charge | 0 |
| Average Mass | 308.506 |
| Monoisotopic Mass | 308.27153 |
| SMILES | [H][C@@]12CC[C@@H](C)[C@](O)(CC/C(C)=C/CO)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C20H36O2/c1-15(10-14-21)9-13-20(22)16(2)7-8-17-18(3,4)11-6-12-19(17,20)5/h10,16-17,21-22H,6-9,11-14H2,1-5H3/b15-10+/t16-,17+,19+,20-/m1/s1 |
| InChIKey | XFADQGUJWIMYJI-UEHSRLBXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Marrubium peregrinum (ncbitaxon:53166) | - | Article (Khim. Prir. Soedin., 1967,301) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| peregrinol (CHEBI:145550) has parent hydride labdane (CHEBI:36505) |
| peregrinol (CHEBI:145550) has role plant metabolite (CHEBI:76924) |
| peregrinol (CHEBI:145550) is a carbobicyclic compound (CHEBI:36785) |
| peregrinol (CHEBI:145550) is a labdane diterpenoid (CHEBI:36770) |
| peregrinol (CHEBI:145550) is a primary allylic alcohol (CHEBI:134394) |
| peregrinol (CHEBI:145550) is a tertiary alcohol (CHEBI:26878) |
| Incoming Relation(s) |
| labd-13Z-ene-9,15,16-triol (CHEBI:145552) has functional parent peregrinol (CHEBI:145550) |
| peregrinol diphosphate (CHEBI:138890) has functional parent peregrinol (CHEBI:145550) |
| IUPAC Name |
|---|
| (1R,2R,4aS,8aS)-1-[(3E)-5-hydroxy-3-methylpent-3-en-1-yl]-2,5,5,8a-tetramethyldecahydronaphthalen-1-ol |
| UniProt Name | Source |
|---|---|
| peregrinol | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:17140-23-7 | ChemIDplus |
| Citations |
|---|