EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H38O8P2 |
| Net Charge | 0 |
| Average Mass | 468.464 |
| Monoisotopic Mass | 468.20419 |
| SMILES | [H][C@@]12CC[C@@H](C)[C@](O)(CC/C(C)=C/COP(=O)(O)OP(=O)(O)O)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C20H38O8P2/c1-15(10-14-27-30(25,26)28-29(22,23)24)9-13-20(21)16(2)7-8-17-18(3,4)11-6-12-19(17,20)5/h10,16-17,21H,6-9,11-14H2,1-5H3,(H,25,26)(H2,22,23,24)/b15-10+/t16-,17+,19+,20-/m1/s1 |
| InChIKey | BXBWAHVSCRSIHO-UEHSRLBXSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| peregrinol diphosphate (CHEBI:138890) has functional parent peregrinol (CHEBI:145550) |
| peregrinol diphosphate (CHEBI:138890) is a diterpenyl phosphate (CHEBI:36772) |
| peregrinol diphosphate (CHEBI:138890) is a labdane diterpenoid (CHEBI:36770) |
| peregrinol diphosphate (CHEBI:138890) is a tertiary alcohol (CHEBI:26878) |
| peregrinol diphosphate (CHEBI:138890) is conjugate acid of peregrinol diphosphate(3−) (CHEBI:138232) |
| Incoming Relation(s) |
| peregrinol diphosphate(3−) (CHEBI:138232) is conjugate base of peregrinol diphosphate (CHEBI:138890) |
| IUPAC Name |
|---|
| (2E)-5-[(1R,2R,4aS,8aS)-1-hydroxy-2,5,5,8a-tetramethyldecahydronaphthalen-1-yl]-3-methylpent-2-en-1-yl trihydrogen diphosphate |
| Manual Xrefs | Databases |
|---|---|
| CPD-20436 | MetaCyc |
| Citations |
|---|