EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N4S |
| Net Charge | 0 |
| Average Mass | 338.480 |
| Monoisotopic Mass | 338.15652 |
| SMILES | Cc1sc2ncnc(N[C@H]3CCN(Cc4ccccc4)C3)c2c1C |
| InChI | InChI=1S/C19H22N4S/c1-13-14(2)24-19-17(13)18(20-12-21-19)22-16-8-9-23(11-16)10-15-6-4-3-5-7-15/h3-7,12,16H,8-11H2,1-2H3,(H,20,21,22)/t16-/m0/s1 |
| InChIKey | VSXRMURGJRAOCU-INIZCTEOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.3.1.85 (fatty acid synthase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of fatty acid synthase (EC 2.3.1.85), a multi-enzyme protein involved in fatty acid synthesis. fatty acid synthesis inhibitor Any pathway inhibitor that inhibits the synthesis of fatty acids. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-Fasnall (CHEBI:145534) has role EC 2.3.1.85 (fatty acid synthase) inhibitor (CHEBI:71476) |
| (S)-Fasnall (CHEBI:145534) has role fatty acid synthesis inhibitor (CHEBI:50185) |
| (S)-Fasnall (CHEBI:145534) is a N-(1-benzylpyrrolidin-3-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine (CHEBI:145528) |
| (S)-Fasnall (CHEBI:145534) is enantiomer of (R)-Fasnall (CHEBI:145533) |
| Incoming Relation(s) |
| Fasnall (CHEBI:145520) has part (S)-Fasnall (CHEBI:145534) |
| (R)-Fasnall (CHEBI:145533) is enantiomer of (S)-Fasnall (CHEBI:145534) |
| IUPAC Name |
|---|
| N-[(3S)-1-benzylpyrrolidin-3-yl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
| Synonym | Source |
|---|---|
| HS-80 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:2138838-57-8 | ChEBI |
| Citations |
|---|