EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N4S |
| Net Charge | 0 |
| Average Mass | 338.480 |
| Monoisotopic Mass | 338.15652 |
| SMILES | Cc1sc2ncnc(NC3CCN(Cc4ccccc4)C3)c2c1C |
| InChI | InChI=1S/C19H22N4S/c1-13-14(2)24-19-17(13)18(20-12-21-19)22-16-8-9-23(11-16)10-15-6-4-3-5-7-15/h3-7,12,16H,8-11H2,1-2H3,(H,20,21,22) |
| InChIKey | VSXRMURGJRAOCU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. fatty acid synthesis inhibitor Any pathway inhibitor that inhibits the synthesis of fatty acids. EC 2.3.1.85 (fatty acid synthase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of fatty acid synthase (EC 2.3.1.85), a multi-enzyme protein involved in fatty acid synthesis. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fasnall (CHEBI:145520) has part (R)-Fasnall (CHEBI:145533) |
| Fasnall (CHEBI:145520) has part (S)-Fasnall (CHEBI:145534) |
| Fasnall (CHEBI:145520) has role anti-HIV agent (CHEBI:64946) |
| Fasnall (CHEBI:145520) has role apoptosis inducer (CHEBI:68495) |
| Fasnall (CHEBI:145520) has role EC 2.3.1.85 (fatty acid synthase) inhibitor (CHEBI:71476) |
| Fasnall (CHEBI:145520) has role fatty acid synthesis inhibitor (CHEBI:50185) |
| Fasnall (CHEBI:145520) is a racemate (CHEBI:60911) |
| IUPAC Name |
|---|
| rac-N-(1-benzylpyrrolidin-3-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
| Registry Numbers | Sources |
|---|---|
| CAS:929978-58-5 | ChEBI |
| Citations |
|---|