EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N4O7S2 |
| Net Charge | 0 |
| Average Mass | 376.372 |
| Monoisotopic Mass | 376.01474 |
| SMILES | COc1nn(C(=O)NS(=O)(=O)c2c(C(=O)O)csc2C)c(=O)n1C |
| InChI | InChI=1S/C11H12N4O7S2/c1-5-7(6(4-23-5)8(16)17)24(20,21)13-9(18)15-11(19)14(2)10(12-15)22-3/h4H,1-3H3,(H,13,18)(H,16,17) |
| InChIKey | GLDAZAQRGCSFNP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 2.2.1.6 (acetolactate synthase) inhibitor An EC 2.2.1.* (transketolase/transaldolase) inhibitor that interferes with the action of acetolactate synthase (EC 2.2.1.6). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | herbicide A substance used to destroy plant pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiencarbazone (CHEBI:145501) has role agrochemical (CHEBI:33286) |
| thiencarbazone (CHEBI:145501) has role EC 2.2.1.6 (acetolactate synthase) inhibitor (CHEBI:22180) |
| thiencarbazone (CHEBI:145501) has role herbicide (CHEBI:24527) |
| thiencarbazone (CHEBI:145501) has role metabolite (CHEBI:25212) |
| thiencarbazone (CHEBI:145501) is a N-sulfonylurea (CHEBI:76983) |
| thiencarbazone (CHEBI:145501) is a ether (CHEBI:25698) |
| thiencarbazone (CHEBI:145501) is a thiophenecarboxylic acid (CHEBI:48436) |
| thiencarbazone (CHEBI:145501) is a triazoles (CHEBI:35727) |
| Incoming Relation(s) |
| thiencarbazone-methyl (CHEBI:145500) has functional parent thiencarbazone (CHEBI:145501) |
| IUPAC Name |
|---|
| 4-[(3-methoxy-4-methyl-5-oxo-4,5-dihydro-1H-1,2,4-triazole-1-carbonyl)sulfamoyl]-5-methylthiophene-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| 4-[[[(4,5-dihydro-3-methoxy-4-methyl-5-oxo-1H-1,2,4-triazol-1-yl)carbonyl]amino]sulfonyl]-5-methyl-3-thiophenecarboxylic acid | Alan Wood's Pesticides |
| 4-[(4,5-dihydro-3-methoxy-4-methyl-5-oxo-1H-1,2,4-triazol-1-yl)carbonylsulfamoyl]-5-methylthiophene-3-carboxylic acid | Alan Wood's Pesticides |
| BYH 18636 carboxylic acid | ChEBI |
| BYH-18636-carboxylic acid | PPDB |
| GSE28226 | PPDB |
| GSE29091 | PPDB |
| Manual Xrefs | Databases |
|---|---|
| 2499 | PPDB |
| thiencarbazone | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23208356 | Reaxys |
| CAS:936331-72-5 | ChemIDplus |
| Citations |
|---|