EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N4O7S2 |
| Net Charge | 0 |
| Average Mass | 376.372 |
| Monoisotopic Mass | 376.01474 |
| SMILES | COc1nn(C(=O)NS(=O)(=O)c2c(C(=O)O)csc2C)c(=O)n1C |
| InChI | InChI=1S/C11H12N4O7S2/c1-5-7(6(4-23-5)8(16)17)24(20,21)13-9(18)15-11(19)14(2)10(12-15)22-3/h4H,1-3H3,(H,13,18)(H,16,17) |
| InChIKey | GLDAZAQRGCSFNP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 2.2.1.6 (acetolactate synthase) inhibitor An EC 2.2.1.* (transketolase/transaldolase) inhibitor that interferes with the action of acetolactate synthase (EC 2.2.1.6). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiencarbazone (CHEBI:145501) has role agrochemical (CHEBI:33286) |
| thiencarbazone (CHEBI:145501) has role EC 2.2.1.6 (acetolactate synthase) inhibitor (CHEBI:22180) |
| thiencarbazone (CHEBI:145501) has role herbicide (CHEBI:24527) |
| thiencarbazone (CHEBI:145501) has role metabolite (CHEBI:25212) |
| thiencarbazone (CHEBI:145501) is a N-sulfonylurea (CHEBI:76983) |
| thiencarbazone (CHEBI:145501) is a ether (CHEBI:25698) |
| thiencarbazone (CHEBI:145501) is a thiophenecarboxylic acid (CHEBI:48436) |
| thiencarbazone (CHEBI:145501) is a triazoles (CHEBI:35727) |
| Incoming Relation(s) |
| thiencarbazone-methyl (CHEBI:145500) has functional parent thiencarbazone (CHEBI:145501) |
| IUPAC Name |
|---|
| 4-[(3-methoxy-4-methyl-5-oxo-4,5-dihydro-1H-1,2,4-triazole-1-carbonyl)sulfamoyl]-5-methylthiophene-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| 4-[[[(4,5-dihydro-3-methoxy-4-methyl-5-oxo-1H-1,2,4-triazol-1-yl)carbonyl]amino]sulfonyl]-5-methyl-3-thiophenecarboxylic acid | Alan Wood's Pesticides |
| 4-[(4,5-dihydro-3-methoxy-4-methyl-5-oxo-1H-1,2,4-triazol-1-yl)carbonylsulfamoyl]-5-methylthiophene-3-carboxylic acid | Alan Wood's Pesticides |
| BYH 18636 carboxylic acid | ChEBI |
| BYH-18636-carboxylic acid | PPDB |
| GSE28226 | PPDB |
| GSE29091 | PPDB |
| Manual Xrefs | Databases |
|---|---|
| 2499 | PPDB |
| thiencarbazone | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23208356 | Reaxys |
| CAS:936331-72-5 | ChemIDplus |
| Citations |
|---|