EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14N4O7S2 |
| Net Charge | 0 |
| Average Mass | 390.399 |
| Monoisotopic Mass | 390.03039 |
| SMILES | COC(=O)c1csc(C)c1S(=O)(=O)NC(=O)n1nc(OC)n(C)c1=O |
| InChI | InChI=1S/C12H14N4O7S2/c1-6-8(7(5-24-6)9(17)22-3)25(20,21)14-10(18)16-12(19)15(2)11(13-16)23-4/h5H,1-4H3,(H,14,18) |
| InChIKey | XSKZXGDFSCCXQX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.2.1.6 (acetolactate synthase) inhibitor An EC 2.2.1.* (transketolase/transaldolase) inhibitor that interferes with the action of acetolactate synthase (EC 2.2.1.6). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiencarbazone-methyl (CHEBI:145500) has functional parent thiencarbazone (CHEBI:145501) |
| thiencarbazone-methyl (CHEBI:145500) has role agrochemical (CHEBI:33286) |
| thiencarbazone-methyl (CHEBI:145500) has role EC 2.2.1.6 (acetolactate synthase) inhibitor (CHEBI:22180) |
| thiencarbazone-methyl (CHEBI:145500) has role herbicide (CHEBI:24527) |
| thiencarbazone-methyl (CHEBI:145500) is a N-sulfonylurea (CHEBI:76983) |
| thiencarbazone-methyl (CHEBI:145500) is a ether (CHEBI:25698) |
| thiencarbazone-methyl (CHEBI:145500) is a methyl ester (CHEBI:25248) |
| thiencarbazone-methyl (CHEBI:145500) is a thiophenes (CHEBI:26961) |
| thiencarbazone-methyl (CHEBI:145500) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| methyl 4-{[(3-methoxy-4-methyl-5-oxo-4,5-dihydro-1H-1,2,4-triazol-1-yl)carbonyl]sulfamoyl}-5-methylthiophene-3-carboxylate |
| Synonyms | Source |
|---|---|
| 3-[N-[(4,5-dihydro-3-methoxy-4-methyl-5-oxo-1H-1,2,4-triazole-1-yl)carbonyl]sulfamoyl]-2-methyl-4-thiophenecarboxylic acid methyl ester | ChEBI |
| BYH 18636 | PPDB |
| methyl 4-[[[(4,5-dihydro-3-methoxy-4-methyl-5-oxo-1H-1,2,4-triazol-1-yl)carbonyl]amino]sulfonyl]-5-methyl-3-thiophenecarboxylate | Alan Wood's Pesticides |
| methyl 4-[(4,5-dihydro-3-methoxy-4-methyl-5-oxo-1H-1,2,4-triazol-1-yl)carbonylsulfamoyl]-5-methylthiophene-3-carboxylate | Alan Wood's Pesticides |
| methyl 4-[(4,5-dihydro-3-methoxy-4-methyl-5-oxo-1H-1,2,4-triazol-1-yl)carboxamidosulfonyl]-5-methylthiophene-3-carboxylate | ChEBI |
| TCM | PPDB |
| Brand Names | Source |
|---|---|
| Adengo | ChEBI |
| Autumn | ChEBI |
| Capreno | ChEBI |
| Celsius | ChEBI |
| Corvus | ChEBI |
| Velocity | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1241 | PPDB |
| 6R5 | PDBeChem |
| /derivatives/thiencarbazone-methyl | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11327106 | Reaxys |
| CAS:317815-83-1 | ChemIDplus |
| Citations |
|---|