EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H18ClFN2O4 |
| Net Charge | 0 |
| Average Mass | 440.858 |
| Monoisotopic Mass | 440.09391 |
| SMILES | C[C@@H](Oc1ccc(Oc2nc3ccc(Cl)cc3o2)cc1)C(=O)N(C)c1ccccc1F |
| InChI | InChI=1S/C23H18ClFN2O4/c1-14(22(28)27(2)20-6-4-3-5-18(20)25)29-16-8-10-17(11-9-16)30-23-26-19-12-7-15(24)13-21(19)31-23/h3-14H,1-2H3/t14-/m1/s1 |
| InChIKey | ADDQHLREJDZPMT-CQSZACIVSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor An EC 6.4.1.* (C‒C bond-forming ligase) inhibitor that interferes with the action of acetyl-CoA carboxylase (EC 6.4.1.2). |
| Application: | phenoxy herbicide Any member of the class of herbicides whose members contain a phenoxy or substituted phenoxy group. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metamifop (CHEBI:145480) has role EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor (CHEBI:70722) |
| metamifop (CHEBI:145480) has role phenoxy herbicide (CHEBI:60575) |
| metamifop (CHEBI:145480) is a 2-{4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenoxy}-N-(2-fluorophenyl)-N-methylpropanamide (CHEBI:145482) |
| metamifop (CHEBI:145480) is enantiomer of (S)-metamifop (CHEBI:145483) |
| Incoming Relation(s) |
| rac-metamifop (CHEBI:145481) has part metamifop (CHEBI:145480) |
| (S)-metamifop (CHEBI:145483) is enantiomer of metamifop (CHEBI:145480) |
| IUPAC Name |
|---|
| (2R)-2-{4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenoxy}-N-(2-fluorophenyl)-N-methylpropanamide |
| Synonyms | Source |
|---|---|
| (2R)-2-[4-[(6-chloro-2-benzoxazolyl)oxy]phenoxy]-N-(2-fluorophenyl)-N-methylpropanamide | Alan Wood's Pesticides |
| DBH-129 | PPDB |
| (R)-2-[4-(6-chloro-1,3-benzoxazol-2-yloxy)phenoxy]-2'-fluoro-N-methylpropionanilide | Alan Wood's Pesticides |
| (R)-metamifop | ChEBI |
| K-12974 | PPDB |
| SAH-001 | ChEBI |
| Brand Name | Source |
|---|---|
| Pyzero | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11210003 | Reaxys |
| CAS:256412-89-2 | ChemIDplus |
| Citations |
|---|