EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H9Cl2FN2O3 |
| Net Charge | 0 |
| Average Mass | 331.130 |
| Monoisotopic Mass | 329.99743 |
| SMILES | COc1c(Cl)ccc(-c2cc(N)c(Cl)c(C(=O)O)n2)c1F |
| InChI | InChI=1S/C13H9Cl2FN2O3/c1-21-12-6(14)3-2-5(10(12)16)8-4-7(17)9(15)11(18-8)13(19)20/h2-4H,1H3,(H2,17,18)(H,19,20) |
| InChIKey | KKLBEFSLWYDQFI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. synthetic auxin A synthetic compound exhibiting auxin activity. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| halauxifen (CHEBI:145477) has role herbicide (CHEBI:24527) |
| halauxifen (CHEBI:145477) has role metabolite (CHEBI:25212) |
| halauxifen (CHEBI:145477) has role synthetic auxin (CHEBI:26841) |
| halauxifen (CHEBI:145477) is a aminopyridine (CHEBI:38207) |
| halauxifen (CHEBI:145477) is a biaryl (CHEBI:64459) |
| halauxifen (CHEBI:145477) is a chloropyridine (CHEBI:39173) |
| halauxifen (CHEBI:145477) is a monochlorobenzenes (CHEBI:83403) |
| halauxifen (CHEBI:145477) is a monofluorobenzenes (CHEBI:83575) |
| halauxifen (CHEBI:145477) is a monomethoxybenzene (CHEBI:25235) |
| halauxifen (CHEBI:145477) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Incoming Relation(s) |
| halauxifen-methyl (CHEBI:143513) has functional parent halauxifen (CHEBI:145477) |
| IUPAC Name |
|---|
| 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)pyridine-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-2-pyridinecarboxylic acid | Alan Wood's Pesticides |
| 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)picolinic acid | Alan Wood's Pesticides |
| halauxifen (free acid) | ChEBI |
| XDE 729 acid | ChEBI |
| XR-729 acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2630 | PPDB |
| halauxifen | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11450600 | Reaxys |
| CAS:943832-60-8 | ChemIDplus |
| Citations |
|---|