EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11Cl2FN2O3 |
| Net Charge | 0 |
| Average Mass | 345.157 |
| Monoisotopic Mass | 344.01308 |
| SMILES | COC(=O)c1nc(-c2ccc(Cl)c(OC)c2F)cc(N)c1Cl |
| InChI | InChI=1S/C14H11Cl2FN2O3/c1-21-13-7(15)4-3-6(11(13)17)9-5-8(18)10(16)12(19-9)14(20)22-2/h3-5H,1-2H3,(H2,18,19) |
| InChIKey | KDHKOPYYWOHESS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| Application: | proherbicide A compound that, on administration, must undergo chemical conversion by biochemical (enzymatic), chemical (possibly following an enzymatic step), or physical (e.g. photochemical) activation processes before becoming the pharmacologically active herbicide for which it is a proherbicide. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| halauxifen-methyl (CHEBI:143513) has functional parent halauxifen (CHEBI:145477) |
| halauxifen-methyl (CHEBI:143513) has role proherbicide (CHEBI:136646) |
| halauxifen-methyl (CHEBI:143513) has role synthetic auxin (CHEBI:26841) |
| halauxifen-methyl (CHEBI:143513) is a aminopyridine (CHEBI:38207) |
| halauxifen-methyl (CHEBI:143513) is a biaryl (CHEBI:64459) |
| halauxifen-methyl (CHEBI:143513) is a chloropyridine (CHEBI:39173) |
| halauxifen-methyl (CHEBI:143513) is a methyl ester (CHEBI:25248) |
| halauxifen-methyl (CHEBI:143513) is a monochlorobenzenes (CHEBI:83403) |
| halauxifen-methyl (CHEBI:143513) is a monofluorobenzenes (CHEBI:83575) |
| halauxifen-methyl (CHEBI:143513) is a monomethoxybenzene (CHEBI:25235) |
| IUPAC Name |
|---|
| methyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)pyridine-2-carboxylate |
| Synonyms | Source |
|---|---|
| methyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)picolinate | Alan Wood's Pesticides |
| methyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-2-pyridinecarboxylate | Alan Wood's Pesticides |
| halauxifen methyl | ChEBI |
| 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)pyridine-2-carboxylic acid methyl ester | ChEBI |
| XR-729 | ChEBI |
| halauxiphen-methyl | ChEBI |
| Brand Names | Source |
|---|---|
| Arylex | ChEBI |
| Pixxaro | ChEBI |
| Quelex | ChEBI |
| Arylex Active | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2631 | PPDB |
| /derivatives/halauxifen-methyl | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:943831-98-9 | ChemIDplus |
| CAS:943831-98-9 | Alan Wood's Pesticides |
| Citations |
|---|