EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N4O4 |
| Net Charge | 0 |
| Average Mass | 252.230 |
| Monoisotopic Mass | 252.08585 |
| SMILES | N#C[C@H]1[C@H](O)[C@@H](CO)O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C10H12N4O4/c11-3-5-8(16)6(4-15)18-9(5)14-2-1-7(12)13-10(14)17/h1-2,5-6,8-9,15-16H,4H2,(H2,12,13,17)/t5-,6+,8-,9+/m0/s1 |
| InChIKey | DCYBPMFXJCWXNB-JWIUVKOKSA-N |
| Roles Classification |
|---|
| Biological Roles: | DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CNDAC (CHEBI:145435) has role antineoplastic agent (CHEBI:35610) |
| CNDAC (CHEBI:145435) has role DNA synthesis inhibitor (CHEBI:59517) |
| CNDAC (CHEBI:145435) has role drug metabolite (CHEBI:49103) |
| CNDAC (CHEBI:145435) is a nitrile (CHEBI:18379) |
| CNDAC (CHEBI:145435) is a pyrimidine 2'-deoxyribonucleoside (CHEBI:19255) |
| Incoming Relation(s) |
| sapacitabine (CHEBI:145429) has functional parent CNDAC (CHEBI:145435) |
| IUPAC Name |
|---|
| 4-amino-1-(2-cyano-2-deoxy-β-D-arabinofuranosyl)pyrimidin-2(1H)-one |
| Synonyms | Source |
|---|---|
| 1-(2-deoxy-2-cyano-β-D-arabinofuranosyl)cytosine | ChEBI |
| 2'-cyano-2'-deoxy-1-(β-D-arabinofuranosyl)cytosine | DrugBank |
| 2'-C-cyano-2'-deoxy-1-β-D-arabino-pentofuranosyl-cytosine | ChEBI |
| DFP10917 | ChEBI |
| TAS 109 | DrugBank |
| TAS-109 | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| DB11667 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:135598-68-4 | ChemIDplus |
| Citations |
|---|