EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42N4O5 |
| Net Charge | 0 |
| Average Mass | 490.645 |
| Monoisotopic Mass | 490.31552 |
| SMILES | CCCCCCCCCCCCCCCC(=O)Nc1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2C#N)c(=O)n1 |
| InChI | InChI=1S/C26H42N4O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-23(32)28-22-16-17-30(26(34)29-22)25-20(18-27)24(33)21(19-31)35-25/h16-17,20-21,24-25,31,33H,2-15,19H2,1H3,(H,28,29,32,34)/t20-,21+,24-,25+/m0/s1 |
| InChIKey | LBGFKUUHOPIEMA-PEARBKPGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sapacitabine (CHEBI:145429) has functional parent CNDAC (CHEBI:145435) |
| sapacitabine (CHEBI:145429) has functional parent hexadecanoic acid (CHEBI:15756) |
| sapacitabine (CHEBI:145429) has role antimetabolite (CHEBI:35221) |
| sapacitabine (CHEBI:145429) has role antineoplastic agent (CHEBI:35610) |
| sapacitabine (CHEBI:145429) has role DNA synthesis inhibitor (CHEBI:59517) |
| sapacitabine (CHEBI:145429) has role prodrug (CHEBI:50266) |
| sapacitabine (CHEBI:145429) is a nitrile (CHEBI:18379) |
| sapacitabine (CHEBI:145429) is a nucleoside analogue (CHEBI:60783) |
| sapacitabine (CHEBI:145429) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 1-(2-cyano-2-deoxy-β-D-arabinofuranosyl)-4-(hexadecanoylamino)pyrimidin-2(1H)-one |
| INNs | Source |
|---|---|
| sapacitabinum | WHO MedNet |
| sapacitabina | WHO MedNet |
| sapacitabine | WHO MedNet |
| sapacitabine | WHO MedNet |
| Synonyms | Source |
|---|---|
| CS-682 | DrugBank |
| CYC-682 | DrugBank |
| CYC682 | DrugBank |
| CS 682 | ChemIDplus |
| CS682 | ChemIDplus |
| CYC 682 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Sapacitabine | Wikipedia |
| DB06365 | DrugBank |
| D09722 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:151823-14-2 | ChemIDplus |
| Citations |
|---|