EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H13ClFN3O2 |
| Net Charge | 0 |
| Average Mass | 357.772 |
| Monoisotopic Mass | 357.06803 |
| SMILES | OCc1ncc2n1-c1ccc(Cl)cc1C(c1ccccc1F)=NC2O |
| InChI | InChI=1S/C18H13ClFN3O2/c19-10-5-6-14-12(7-10)17(11-3-1-2-4-13(11)20)22-18(25)15-8-21-16(9-24)23(14)15/h1-8,18,24-25H,9H2 |
| InChIKey | OJDUJEPGFILARE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Application: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1',4-dihydroxymidazolam (CHEBI:145332) has functional parent midazolam (CHEBI:6931) |
| 1',4-dihydroxymidazolam (CHEBI:145332) has role drug metabolite (CHEBI:49103) |
| 1',4-dihydroxymidazolam (CHEBI:145332) is a aromatic primary alcohol (CHEBI:33857) |
| 1',4-dihydroxymidazolam (CHEBI:145332) is a imidazobenzodiazepine (CHEBI:142118) |
| 1',4-dihydroxymidazolam (CHEBI:145332) is a monofluorobenzenes (CHEBI:83575) |
| 1',4-dihydroxymidazolam (CHEBI:145332) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 8-chloro-6-(2-fluorophenyl)-1-(hydroxymethyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-4-ol |
| Synonyms | Source |
|---|---|
| 1',4-dihydroxy midazolam | ChEBI |
| 1,4-dihydroxy midazolam | ChEBI |
| 1,4-dihydroxymidazolam | ChEBI |
| 1',4'-dihydroxymidazolam | ChEBI |
| 8-chloro-6-(2-fluorophenyl)-4-hydroxy-4H-imidazo[1,5-a][1,4]benzodiazepine-1-methanol | ChEBI |
| Ro 21-0284 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:64740-68-7 | ChEBI |
| Citations |
|---|