EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N2O3S |
| Net Charge | 0 |
| Average Mass | 306.387 |
| Monoisotopic Mass | 306.10381 |
| SMILES | O=C(CCCc1cnc2ccccc12)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C15H18N2O3S/c18-14(17-13(9-21)15(19)20)7-3-4-10-8-16-12-6-2-1-5-11(10)12/h1-2,5-6,8,13,16,21H,3-4,7,9H2,(H,17,18)(H,19,20)/t13-/m0/s1 |
| InChIKey | LXMVSQPUILWDOQ-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[4-(indol-3-yl)butanoyl]-L-cysteine (CHEBI:145322) is a N-acyl-L-α-amino acid (CHEBI:48927) |
| N-[4-(indol-3-yl)butanoyl]-L-cysteine (CHEBI:145322) is a indoles (CHEBI:24828) |
| N-[4-(indol-3-yl)butanoyl]-L-cysteine (CHEBI:145322) is a secondary carboxamide (CHEBI:140325) |
| N-[4-(indol-3-yl)butanoyl]-L-cysteine (CHEBI:145322) is a thiol (CHEBI:29256) |
| N-[4-(indol-3-yl)butanoyl]-L-cysteine (CHEBI:145322) is conjugate acid of N-[4-(indol-3-yl)butanoyl]-L-cysteinate (CHEBI:143280) |
| Incoming Relation(s) |
| N-[4-(indol-3-yl)butanoyl]-L-cysteinate (CHEBI:143280) is conjugate base of N-[4-(indol-3-yl)butanoyl]-L-cysteine (CHEBI:145322) |
| IUPAC Name |
|---|
| N-[4-(1H-indol-3-yl)butanoyl]-L-cysteine |
| Citations |
|---|