EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17N2O3S |
| Net Charge | -1 |
| Average Mass | 305.379 |
| Monoisotopic Mass | 305.09654 |
| SMILES | O=C(CCCc1cnc2ccccc12)N[C@@H](CS)C(=O)[O-] |
| InChI | InChI=1S/C15H18N2O3S/c18-14(17-13(9-21)15(19)20)7-3-4-10-8-16-12-6-2-1-5-11(10)12/h1-2,5-6,8,13,16,21H,3-4,7,9H2,(H,17,18)(H,19,20)/p-1/t13-/m0/s1 |
| InChIKey | LXMVSQPUILWDOQ-ZDUSSCGKSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[4-(indol-3-yl)butanoyl]-L-cysteinate (CHEBI:143280) is a N-acyl-L-α-amino acid anion (CHEBI:59874) |
| N-[4-(indol-3-yl)butanoyl]-L-cysteinate (CHEBI:143280) is conjugate base of N-[4-(indol-3-yl)butanoyl]-L-cysteine (CHEBI:145322) |
| Incoming Relation(s) |
| N-[4-(indol-3-yl)butanoyl]-L-cysteine (CHEBI:145322) is conjugate acid of N-[4-(indol-3-yl)butanoyl]-L-cysteinate (CHEBI:143280) |
| IUPAC Name |
|---|
| N-[4-(1H-indol-3-yl)butanoyl]-L-cysteinate |
| UniProt Name | Source |
|---|---|
| (indol-3-yl)butanoyl-L-cysteine | UniProt |
| Citations |
|---|