EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27N2O3 |
| Net Charge | +1 |
| Average Mass | 367.469 |
| Monoisotopic Mass | 367.20162 |
| SMILES | COc1ccc(CCCOC(Cn2cc[nH+]c2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H26N2O3/c1-25-20-9-5-18(6-10-20)4-3-15-27-22(16-24-14-13-23-17-24)19-7-11-21(26-2)12-8-19/h5-14,17,22H,3-4,15-16H2,1-2H3/p+1 |
| InChIKey | HLMBXBGDBBCYII-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SKF-96365 free base(1+) (CHEBI:145128) is a organic cation (CHEBI:25697) |
| SKF-96365 free base(1+) (CHEBI:145128) is conjugate acid of SKF-96365 free base (CHEBI:145122) |
| Incoming Relation(s) |
| SKF-96365 hydrochloride (CHEBI:145121) has part SKF-96365 free base(1+) (CHEBI:145128) |
| SKF-96365 free base (CHEBI:145122) is conjugate base of SKF-96365 free base(1+) (CHEBI:145128) |
| IUPAC Name |
|---|
| 1-{2-(4-methoxyphenyl)-2-[3-(4-methoxyphenyl)propoxy]ethyl}-1H-imidazol-3-ium |
| Synonym | Source |
|---|---|
| SKF-96365 cation | ChEBI |