EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26N2O3.HCl |
| Net Charge | 0 |
| Average Mass | 402.922 |
| Monoisotopic Mass | 402.17102 |
| SMILES | COc1ccc(CCCOC(Cn2ccnc2)c2ccc(OC)cc2)cc1.[H]Cl |
| InChI | InChI=1S/C22H26N2O3.ClH/c1-25-20-9-5-18(6-10-20)4-3-15-27-22(16-24-14-13-23-17-24)19-7-11-21(26-2)12-8-19;/h5-14,17,22H,3-4,15-16H2,1-2H3;1H |
| InChIKey | FWLPKVQUECFKSW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. TRP channel blocker An agent that inhibits the passage of cations through the transient receptor potential (TRP) channels. autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. GABA antagonist A compound that inhibits the action of γ-aminobutyric acid. |
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. GABA antagonist A compound that inhibits the action of γ-aminobutyric acid. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SKF-96365 hydrochloride (CHEBI:145121) has part SKF-96365 free base(1+) (CHEBI:145128) |
| SKF-96365 hydrochloride (CHEBI:145121) has role antineoplastic agent (CHEBI:35610) |
| SKF-96365 hydrochloride (CHEBI:145121) has role apoptosis inducer (CHEBI:68495) |
| SKF-96365 hydrochloride (CHEBI:145121) has role autophagy inducer (CHEBI:138880) |
| SKF-96365 hydrochloride (CHEBI:145121) has role calcium channel blocker (CHEBI:38215) |
| SKF-96365 hydrochloride (CHEBI:145121) has role GABA antagonist (CHEBI:65259) |
| SKF-96365 hydrochloride (CHEBI:145121) has role platelet aggregation inhibitor (CHEBI:50427) |
| SKF-96365 hydrochloride (CHEBI:145121) has role TRP channel blocker (CHEBI:139361) |
| SKF-96365 hydrochloride (CHEBI:145121) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1-{2-(4-methoxyphenyl)-2-[3-(4-methoxyphenyl)propoxy]ethyl}-1H-imidazole hydrochloride |
| Synonyms | Source |
|---|---|
| 1-(2-(3-(4-methoxyphenyl)propoxy)-4-methoxyphenylethyl)-1H-imidazole hydrochloride | ChEBI |
| SK&F 96365 | ChemIDplus |
| SK&F-96365 | ChEBI |
| SKF-963656 | ChEBI |
| SKF963656 | SUBMITTER |
| SKF-96365 HCl | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7402134 | Reaxys |
| CAS:130495-35-1 | ChemIDplus |
| Citations |
|---|