EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:145121 - SKF-96365 hydrochloride
| Formula | C22H26N2O3.HCl |
| Net Charge | 0 |
| Average Mass | 402.922 |
| Monoisotopic Mass | 402.17102 |
| SMILES | COc1ccc(CCCOC(Cn2ccnc2)c2ccc(OC)cc2)cc1.[H]Cl |
| InChI | InChI=1S/C22H26N2O3.ClH/c1-25-20-9-5-18(6-10-20)4-3-15-27-22(16-24-14-13-23-17-24)19-7-11-21(26-2)12-8-19;/h5-14,17,22H,3-4,15-16H2,1-2H3;1H |
| InChIKey | FWLPKVQUECFKSW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). GABA antagonist A compound that inhibits the action of γ-aminobutyric acid. TRP channel blocker An agent that inhibits the passage of cations through the transient receptor potential (TRP) channels. calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | GABA antagonist A compound that inhibits the action of γ-aminobutyric acid. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SKF-96365 hydrochloride (CHEBI:145121) has part SKF-96365 free base(1+) (CHEBI:145128) |
| SKF-96365 hydrochloride (CHEBI:145121) has role antineoplastic agent (CHEBI:35610) |
| SKF-96365 hydrochloride (CHEBI:145121) has role apoptosis inducer (CHEBI:68495) |
| SKF-96365 hydrochloride (CHEBI:145121) has role autophagy inducer (CHEBI:138880) |
| SKF-96365 hydrochloride (CHEBI:145121) has role calcium channel blocker (CHEBI:38215) |
| SKF-96365 hydrochloride (CHEBI:145121) has role GABA antagonist (CHEBI:65259) |
| SKF-96365 hydrochloride (CHEBI:145121) has role platelet aggregation inhibitor (CHEBI:50427) |
| SKF-96365 hydrochloride (CHEBI:145121) has role TRP channel blocker (CHEBI:139361) |
| SKF-96365 hydrochloride (CHEBI:145121) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1-{2-(4-methoxyphenyl)-2-[3-(4-methoxyphenyl)propoxy]ethyl}-1H-imidazole hydrochloride |
| Synonyms | Source |
|---|---|
| 1-(2-(3-(4-methoxyphenyl)propoxy)-4-methoxyphenylethyl)-1H-imidazole hydrochloride | ChEBI |
| SK&F 96365 | ChemIDplus |
| SK&F-96365 | ChEBI |
| SKF-963656 | ChEBI |
| SKF963656 | SUBMITTER |
| SKF-96365 HCl | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7402134 | Reaxys |
| CAS:130495-35-1 | ChemIDplus |
| Citations |
|---|