EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:144984 - NSC 23766
| ChEBI ID | CHEBI:144984 |
| ChEBI Name | NSC 23766 |
| Stars | |
| Definition | An aminopyrimidine that is 6-methylpyrimidine-2,4-diamine in which the amino groups at positions 2 and 4 are substituted by 5-(diethylamino)pentan-2-yl and 4-amino-2-methylquinolin-6-yl groups respectively. An inhibitor of the signalling G-protein known as RAC1 (Ras-related C3 botulinum toxin substrate 1). |
| Secondary ChEBI ID | CHEBI:91883 |
| Last Modified | 4 February 2020 |
| Submitter | Gareth Owen |
| Downloads |
| Formula | C24H35N7 |
| Net Charge | 0 |
| Average Mass | 421.593 |
| Monoisotopic Mass | 421.29539 |
| SMILES | CCN(CC)CCCC(C)Nc1nc(C)cc(Nc2ccc3nc(C)cc(N)c3c2)n1 |
| InChI | InChI=1S/C24H35N7/c1-6-31(7-2)12-8-9-16(3)27-24-28-18(5)14-23(30-24)29-19-10-11-22-20(15-19)21(25)13-17(4)26-22/h10-11,13-16H,6-9,12H2,1-5H3,(H2,25,26)(H2,27,28,29,30) |
| InChIKey | DEFBCZWQLILOJF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 3.6.5.2 (small monomeric GTPase) inhibitor Any EC 3.6.5.* (hydrolases acting on GTP; involved in cellular and subcellular movement) inhibitor that interferes with the action of small monomeric GTPase (EC 3.6.5.2). antiviral agent A substance that destroys or inhibits replication of viruses. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Application: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NSC 23766 (CHEBI:144984) has role antiviral agent (CHEBI:22587) |
| NSC 23766 (CHEBI:144984) has role apoptosis inducer (CHEBI:68495) |
| NSC 23766 (CHEBI:144984) has role EC 3.6.5.2 (small monomeric GTPase) inhibitor (CHEBI:144981) |
| NSC 23766 (CHEBI:144984) has role muscarinic antagonist (CHEBI:48876) |
| NSC 23766 (CHEBI:144984) is a aminopyrimidine (CHEBI:38338) |
| NSC 23766 (CHEBI:144984) is a aminoquinoline (CHEBI:36709) |
| NSC 23766 (CHEBI:144984) is a primary amino compound (CHEBI:50994) |
| NSC 23766 (CHEBI:144984) is a secondary amino compound (CHEBI:50995) |
| NSC 23766 (CHEBI:144984) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| NSC 23766 trihydrochloride (CHEBI:144949) has part NSC 23766 (CHEBI:144984) |
| IUPAC Name |
|---|
| N6-(2-{[5-(diethylamino)pentan-2-yl]amino}-6-methylpyrimidin-4-yl)-2-methylquinoline-4,6-diamine |
| Synonyms | Source |
|---|---|
| NSC23766 | ChEBI |
| NSC-23766 | ChEBI |
| N6-[2-[5-(diethylamino)pentan-2-ylamino]-6-methyl-4-pyrimidinyl]-2-methylquinoline-4,6-diamine | LINCS |
| Manual Xrefs | Databases |
|---|---|
| LSM-1818 | LINCS |
| Citations |
|---|