EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H35N7.3HCl |
| Net Charge | 0 |
| Average Mass | 530.976 |
| Monoisotopic Mass | 529.22543 |
| SMILES | CCN(CC)CCCC(C)Nc1nc(C)cc(Nc2ccc3nc(C)cc(N)c3c2)n1.Cl.Cl.Cl |
| InChI | InChI=1S/C24H35N7.3ClH/c1-6-31(7-2)12-8-9-16(3)27-24-28-18(5)14-23(30-24)29-19-10-11-22-20(15-19)21(25)13-17(4)26-22;;;/h10-11,13-16H,6-9,12H2,1-5H3,(H2,25,26)(H2,27,28,29,30);3*1H |
| InChIKey | CPUHORIUXPQCHW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. EC 3.6.5.2 (small monomeric GTPase) inhibitor Any EC 3.6.5.* (hydrolases acting on GTP; involved in cellular and subcellular movement) inhibitor that interferes with the action of small monomeric GTPase (EC 3.6.5.2). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NSC 23766 trihydrochloride (CHEBI:144949) has part NSC 23766 (CHEBI:144984) |
| NSC 23766 trihydrochloride (CHEBI:144949) has role antiviral agent (CHEBI:22587) |
| NSC 23766 trihydrochloride (CHEBI:144949) has role apoptosis inducer (CHEBI:68495) |
| NSC 23766 trihydrochloride (CHEBI:144949) has role EC 3.6.5.2 (small monomeric GTPase) inhibitor (CHEBI:144981) |
| NSC 23766 trihydrochloride (CHEBI:144949) has role muscarinic antagonist (CHEBI:48876) |
| NSC 23766 trihydrochloride (CHEBI:144949) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N6-(2-{[5-(diethylamino)pentan-2-yl]amino}-6-methylpyrimidin-4-yl)-2-methylquinoline-4,6-diamine trihydrochloride |
| Synonyms | Source |
|---|---|
| NSC 23766·3HCl | SUBMITTER |
| NSC-23766·3HCl | ChEBI |
| NSC23766·3HCl | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1177865-17-6 | SUBMITTER |