EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H35N7.3HCl |
| Net Charge | 0 |
| Average Mass | 530.976 |
| Monoisotopic Mass | 529.22543 |
| SMILES | CCN(CC)CCCC(C)Nc1nc(C)cc(Nc2ccc3nc(C)cc(N)c3c2)n1.Cl.Cl.Cl |
| InChI | InChI=1S/C24H35N7.3ClH/c1-6-31(7-2)12-8-9-16(3)27-24-28-18(5)14-23(30-24)29-19-10-11-22-20(15-19)21(25)13-17(4)26-22;;;/h10-11,13-16H,6-9,12H2,1-5H3,(H2,25,26)(H2,27,28,29,30);3*1H |
| InChIKey | CPUHORIUXPQCHW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 3.6.5.2 (small monomeric GTPase) inhibitor Any EC 3.6.5.* (hydrolases acting on GTP; involved in cellular and subcellular movement) inhibitor that interferes with the action of small monomeric GTPase (EC 3.6.5.2). muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Application: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NSC 23766 trihydrochloride (CHEBI:144949) has part NSC 23766 (CHEBI:144984) |
| NSC 23766 trihydrochloride (CHEBI:144949) has role antiviral agent (CHEBI:22587) |
| NSC 23766 trihydrochloride (CHEBI:144949) has role apoptosis inducer (CHEBI:68495) |
| NSC 23766 trihydrochloride (CHEBI:144949) has role EC 3.6.5.2 (small monomeric GTPase) inhibitor (CHEBI:144981) |
| NSC 23766 trihydrochloride (CHEBI:144949) has role muscarinic antagonist (CHEBI:48876) |
| NSC 23766 trihydrochloride (CHEBI:144949) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N6-(2-{[5-(diethylamino)pentan-2-yl]amino}-6-methylpyrimidin-4-yl)-2-methylquinoline-4,6-diamine trihydrochloride |
| Synonyms | Source |
|---|---|
| NSC 23766·3HCl | SUBMITTER |
| NSC23766·3HCl | ChEBI |
| NSC-23766·3HCl | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1177865-17-6 | SUBMITTER |