EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | [H]C(CC=C(C)C)=C(C)CCO |
| InChI | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5-6,11H,4,7-8H2,1-3H3 |
| InChIKey | DTHIOPUFUOMHAY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citrus aurantiifolia (ncbitaxon:159033) | leaf (BTO:0000713) | PubMed (30273946) | |
| Rhodiola fastigiata (ncbitaxon:203003) | - | PubMed (12710720) | |
| Vitis vinifera (ncbitaxon:29760) | - | Article (Shoseyov, O., Bravdo, B.A., Siegel, D., Goldman, A., Cohen, S. and Ikan, R. (1990) Iso-geraniol (3,7-dimethyl-3,6-octadien-1-ol): A novel monoterpene in Vitis vinifera L. cv. Muscat Roy, Vitis, 29, 159-163.) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isogeraniol (CHEBI:144860) has role plant metabolite (CHEBI:76924) |
| isogeraniol (CHEBI:144860) is a homoallylic alcohol (CHEBI:134362) |
| isogeraniol (CHEBI:144860) is a monoterpenoid (CHEBI:25409) |
| isogeraniol (CHEBI:144860) is a primary alcohol (CHEBI:15734) |
| Incoming Relation(s) |
| cis-isogeraniol (CHEBI:144706) is a isogeraniol (CHEBI:144860) |
| trans-isogeraniol (CHEBI:144710) is a isogeraniol (CHEBI:144860) |
| IUPAC Name |
|---|
| 3,7-dimethylocta-3,6-dien-1-ol |
| Synonym | Source |
|---|---|
| iso-geraniol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:7779-06-8 | ChEBI |
| Citations |
|---|