EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:144706 - cis-isogeraniol
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | CC(C)=CC/C=C(/C)CCO |
| InChI | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5-6,11H,4,7-8H2,1-3H3/b10-6- |
| InChIKey | DTHIOPUFUOMHAY-POHAHGRESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vitis vinifera (ncbitaxon:29760) | |||
| berry (BTO:0000119) | MetaboLights (MTBLS968) | Strain: Vitis vinifera L. cv. Zaomeiguixiang | |
| berry (BTO:0000119) | MetaboLights (MTBLS968) | Strain: Vitis vinifera L. cv. Xiangfei | |
| berry (BTO:0000119) | MetaboLights (MTBLS968) | Strain: Vitis vinifera L. cv. Italia | |
| Elsholtzia ciliata (ncbitaxon:662901) | - | PubMed (28654013) | |
| Backhousia citriodora (ncbitaxon:39976) | - | DOI (10.1080/10412905.2001.9699680) |
| Roles Classification |
|---|
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-isogeraniol (CHEBI:144706) has role pheromone (CHEBI:26013) |
| cis-isogeraniol (CHEBI:144706) has role plant metabolite (CHEBI:76924) |
| cis-isogeraniol (CHEBI:144706) is a isogeraniol (CHEBI:144860) |
| cis-isogeraniol (CHEBI:144706) is a monoterpenoid (CHEBI:25409) |
| IUPAC Name |
|---|
| (3Z)-3,7-dimethylocta-3,6-dien-1-ol |
| Synonyms | Source |
|---|---|
| (3Z)-isogeraniol | ChEBI |
| (3Z)-3,7-dimethyl-3,6-octadien-1-ol | ChEBI |
| (Z)-iso-geraniol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| FDB029713 | FooDB |
| LMFA05000127 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:5944-20-7 | ChEBI |
| Citations |
|---|