EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7NO3 |
| Net Charge | 0 |
| Average Mass | 129.115 |
| Monoisotopic Mass | 129.04259 |
| SMILES | C#C[C@@H](O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H7NO3/c1-2-3(7)4(6)5(8)9/h1,3-4,7H,6H2,(H,8,9)/t3-,4+/m1/s1 |
| InChIKey | RBWXRFBKVDBXEG-DMTCNVIQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sclerotium rolfsii (ncbitaxon:39291) | - | Article (Potgieter, H.C., Vermeulen, N.M.J., Potgieter, D.J.J. and Strauss, H.F. (1977) A toxic amino acid, 2(S)3(R)-2-amino-3-hydroxypent-4-ynoic acid from the fungus Sclerotiua rolfsii. Phytochemistry, 16, 1757-1759.) | |
| Streptomyces cattleya (ncbitaxon:29303) | - | PubMed (3082841) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-β-ethynylserine (CHEBI:144833) has functional parent L-propargylglycine (CHEBI:43797) |
| L-β-ethynylserine (CHEBI:144833) has role antibacterial agent (CHEBI:33282) |
| L-β-ethynylserine (CHEBI:144833) has role antimetabolite (CHEBI:35221) |
| L-β-ethynylserine (CHEBI:144833) has role bacterial metabolite (CHEBI:76969) |
| L-β-ethynylserine (CHEBI:144833) has role fungal metabolite (CHEBI:76946) |
| L-β-ethynylserine (CHEBI:144833) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-β-ethynylserine (CHEBI:144833) is a terminal acetylenic compound (CHEBI:73477) |
| L-β-ethynylserine (CHEBI:144833) is tautomer of L-β-ethynylserine zwitterion (CHEBI:144729) |
| Incoming Relation(s) |
| L-β-ethynylserine zwitterion (CHEBI:144729) is tautomer of L-β-ethynylserine (CHEBI:144833) |
| IUPAC Name |
|---|
| 2-amino-2,4,5-trideoxy-D-threo-pent-4-ynonic acid |
| Synonyms | Source |
|---|---|
| 2-amino-2,4,5-trideoxy-D-threo-pent-4-ynonic acid | ChEBI |
| (2S,3R)-2-amino-3-hydroxy-4-pentynoic acid | ChEBI |
| (2S,3R)-2-amino-3-hydroxypent-4-ynoic acid | ChEBI |
| L-β-ethynylserine | ChEBI |
| β-ethynylserine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:64918-85-0 | ChemIDplus |
| CAS:65207-64-9 | ChemIDplus |
| Citations |
|---|